Difference between revisions of "RXN-9650"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-458 CPD-458] == * smiles: ** C(C1(OC(C(C(C1O)O)O)OC2(C(C(C(C(C2O)O)O)O)O)))O * inchi key: *...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9650 RXN-9650] == * direction: ** LEFT-TO-RIGHT * common name: ** polyketide_synthase ** 3-oxoa...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-458 CPD-458] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9650 RXN-9650] ==
−
* smiles:
+
* direction:
−
** C(C1(OC(C(C(C1O)O)O)OC2(C(C(C(C(C2O)O)O)O)O)))O
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=VCWMRQDBPZKXKG-XIDCDEPRSA-N
+
 
* common name:
 
* common name:
−
** galactinol
+
** polyketide_synthase
−
* molecular weight:
+
** 3-oxoacyl-synthase
−
** 342.299   
+
* ec number:
 +
** [http://enzyme.expasy.org/EC/2.3.1.86 EC-2.3.1.86]
 +
** [http://enzyme.expasy.org/EC/2.3.1.85 EC-2.3.1.85]
 +
** [http://enzyme.expasy.org/EC/2.3.1.41 EC-2.3.1.41]
 
* Synonym(s):
 
* Synonym(s):
−
** 1-O-α-D-galactosyl-D-myo-inositol
 
−
** 1-α-D-galactosyl-myo-inositol
 
−
** α-D-galactosyl-(1->3)-1D-myo-inositol
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-8281]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[Hexanoyl-ACPs]][c] '''+''' 1 [[MALONYL-COA]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[3-Oxo-octanoyl-ACPs]][c] '''+''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[CO-A]][c]
−
* [[2.4.1.123-RXN]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 a hexanoyl-[acyl-carrier-protein][c] '''+''' 1 malonyl-CoA[c] '''+''' 1 H+[c] '''=>''' 1 a 3-oxo-octanoyl-[acp][c] '''+''' 1 CO2[c] '''+''' 1 coenzyme A[c]
−
* [[2.4.1.67-RXN]]
+
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_135]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_14485]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_136]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_10876]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_19302]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_15991]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_13394]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_500]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_5939]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-5994]], palmitate biosynthesis I (animals and fungi): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5994 PWY-5994]
 +
** '''31''' reactions found over '''31''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202439 25202439]
+
{{#set: common name=polyketide_synthase}}
−
* KEGG-GLYCAN : G10488
+
{{#set: common name=3-oxoacyl-synthase}}
−
* HMDB : HMDB05826
+
{{#set: ec number=EC-2.3.1.86}}
−
* LIGAND-CPD:
+
{{#set: ec number=EC-2.3.1.85}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01235 C01235]
+
{{#set: ec number=EC-2.3.1.41}}
−
* CHEBI:
+
{{#set: gene associated=Tiso_gene_135|Tiso_gene_14485|Tiso_gene_136|Tiso_gene_10876|Tiso_gene_19302|Tiso_gene_15991|Tiso_gene_13394|Tiso_gene_500|Tiso_gene_5939}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17505 17505]
+
{{#set: in pathway=PWY-5994}}
−
* METABOLIGHTS : MTBLC17505
+
{{#set: reconstruction category=orthology|annotation}}
−
{{#set: smiles=C(C1(OC(C(C(C1O)O)O)OC2(C(C(C(C(C2O)O)O)O)O)))O}}
+
{{#set: reconstruction source=annotation-experimental_annotation|annotation-in-silico_annotation|orthology-esiliculosus}}
−
{{#set: inchi key=InChIKey=VCWMRQDBPZKXKG-XIDCDEPRSA-N}}
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
−
{{#set: common name=galactinol}}
+
−
{{#set: molecular weight=342.299    }}
+
−
{{#set: common name=1-O-α-D-galactosyl-D-myo-inositol|1-α-D-galactosyl-myo-inositol|α-D-galactosyl-(1->3)-1D-myo-inositol}}
+
−
{{#set: consumed by=RXN-8281}}
+
−
{{#set: produced by=2.4.1.123-RXN}}
+
−
{{#set: consumed or produced by=2.4.1.67-RXN}}
+

Latest revision as of 20:24, 21 March 2018

Reaction RXN-9650

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5994, palmitate biosynthesis I (animals and fungi): PWY-5994
    • 31 reactions found over 31 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-9650&oldid=48424"