Difference between revisions of "CPD-710"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_14247 == * left end position: ** 191 * transcription direction: ** POSITIVE * right end position: ** 1654 * centisome position: ** 3.320007...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-710 CPD-710] == * smiles: ** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CC...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-710 CPD-710] == |
− | * | + | * smiles: |
− | ** | + | ** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34)))) |
− | * | + | * common name: |
− | ** | + | ** campestanol |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=ARYTXMNEANMLMU-ATEDBJNTSA-N |
− | * | + | * molecular weight: |
− | ** | + | ** 402.702 |
* Synonym(s): | * Synonym(s): | ||
+ | ** 5α-campestanol | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-773]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=119394 119394] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=36799 36799] |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C15787 C15787] |
+ | {{#set: smiles=CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))}} | ||
+ | {{#set: common name=campestanol}} | ||
+ | {{#set: inchi key=InChIKey=ARYTXMNEANMLMU-ATEDBJNTSA-N}} | ||
+ | {{#set: molecular weight=402.702 }} | ||
+ | {{#set: common name=5α-campestanol}} | ||
+ | {{#set: consumed by=RXN-773}} |
Latest revision as of 20:24, 21 March 2018
Contents
Metabolite CPD-710
- smiles:
- CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
- common name:
- campestanol
- inchi key:
- InChIKey=ARYTXMNEANMLMU-ATEDBJNTSA-N
- molecular weight:
- 402.702
- Synonym(s):
- 5α-campestanol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.