Difference between revisions of "CPD-710"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_14247 == * left end position: ** 191 * transcription direction: ** POSITIVE * right end position: ** 1654 * centisome position: ** 3.320007...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-710 CPD-710] == * smiles: ** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CC...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_14247 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-710 CPD-710] ==
* left end position:
+
* smiles:
** 191
+
** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
* transcription direction:
+
* common name:
** POSITIVE
+
** campestanol
* right end position:
+
* inchi key:
** 1654
+
** InChIKey=ARYTXMNEANMLMU-ATEDBJNTSA-N
* centisome position:
+
* molecular weight:
** 3.320007    
+
** 402.702    
 
* Synonym(s):
 
* Synonym(s):
 +
** 5α-campestanol
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[SUCROSE-PHOSPHATE-SYNTHASE-RXN]]
+
* [[RXN-773]]
** in-silico_annotation
+
== Reaction(s) known to produce the compound ==
***automated-name-match
+
== Reaction(s) of unknown directionality ==
== Pathways associated ==
+
* [[PWY-7238]]
+
* [[PWY-7347]]
+
* [[SUCSYN-PWY]]
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=191}}
+
* PUBCHEM:
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=119394 119394]
{{#set: right end position=1654}}
+
* CHEBI:
{{#set: centisome position=3.320007   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=36799 36799]
{{#set: reaction associated=SUCROSE-PHOSPHATE-SYNTHASE-RXN}}
+
* LIGAND-CPD:
{{#set: pathway associated=PWY-7238|PWY-7347|SUCSYN-PWY}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C15787 C15787]
 +
{{#set: smiles=CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
 +
{{#set: common name=campestanol}}
 +
{{#set: inchi key=InChIKey=ARYTXMNEANMLMU-ATEDBJNTSA-N}}
 +
{{#set: molecular weight=402.702   }}
 +
{{#set: common name=5α-campestanol}}
 +
{{#set: consumed by=RXN-773}}

Latest revision as of 20:24, 21 March 2018

Metabolite CPD-710

  • smiles:
    • CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
  • common name:
    • campestanol
  • inchi key:
    • InChIKey=ARYTXMNEANMLMU-ATEDBJNTSA-N
  • molecular weight:
    • 402.702
  • Synonym(s):
    • 5α-campestanol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.