Difference between revisions of "CPD-196"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=CDPDIGLYSYN-RXN CDPDIGLYSYN-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** phosphatidate_c...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-196 CPD-196] == * smiles: ** CCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-196 CPD-196] == |
− | * | + | * smiles: |
− | ** | + | ** CCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
* common name: | * common name: | ||
− | ** | + | ** octanoyl-CoA |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=KQMZYOXOBSXMII-CECATXLMSA-J |
+ | * molecular weight: | ||
+ | ** 889.7 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** Octanoyl-CoA (n-C8:0CoA) | ||
+ | ** capryloyl-CoA | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-12669]] | |
− | + | * [[ACOA80or]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-13617]] | |
− | + | * [[R223-RXN]] | |
− | = | + | == Reaction(s) of unknown directionality == |
− | + | * [[RXN-14229]] | |
− | * [[ | + | * [[ACACT4]] |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | * [[ | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | == | + | |
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * BIGG : occoa |
− | ** [http:// | + | * PUBCHEM: |
− | * LIGAND- | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245711 25245711] |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | * HMDB : HMDB01070 |
− | * | + | * LIGAND-CPD: |
− | ** [http://www. | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01944 C01944] |
− | + | * CHEBI: | |
− | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57386 57386] | |
− | * | + | * METABOLIGHTS : MTBLC57386 |
− | + | {{#set: smiles=CCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | |
− | + | {{#set: common name=octanoyl-CoA}} | |
− | + | {{#set: inchi key=InChIKey=KQMZYOXOBSXMII-CECATXLMSA-J}} | |
− | {{#set: | + | {{#set: molecular weight=889.7 }} |
− | {{#set: common name= | + | {{#set: common name=Octanoyl-CoA (n-C8:0CoA)|capryloyl-CoA}} |
− | {{#set: | + | {{#set: consumed by=RXN-12669|ACOA80or}} |
− | {{#set: | + | {{#set: produced by=RXN-13617|R223-RXN}} |
− | {{#set: | + | {{#set: reversible reaction associated=RXN-14229|ACACT4}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + |
Latest revision as of 20:24, 21 March 2018
Contents
Metabolite CPD-196
- smiles:
- CCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- common name:
- octanoyl-CoA
- inchi key:
- InChIKey=KQMZYOXOBSXMII-CECATXLMSA-J
- molecular weight:
- 889.7
- Synonym(s):
- Octanoyl-CoA (n-C8:0CoA)
- capryloyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- BIGG : occoa
- PUBCHEM:
- HMDB : HMDB01070
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC57386
"CCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.