Difference between revisions of "RXN-5962"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-139 CPD1F-139] == * smiles: ** C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC(O)2)([CH](CC3)4)...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-5962 RXN-5962] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/1....")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-139 CPD1F-139] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-5962 RXN-5962] ==
* smiles:
+
* direction:
** C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC(O)2)([CH](CC3)4)5)(C)))C([O-])=O)))
+
** LEFT-TO-RIGHT
* inchi key:
+
* ec number:
** InChIKey=JLJLRLWOEMWYQK-SNTJWBGVSA-M
+
** [http://enzyme.expasy.org/EC/1.14.99.45 EC-1.14.99.45]
* common name:
+
** gibberellin A1
+
* molecular weight:
+
** 347.387   
+
 
* Synonym(s):
 
* Synonym(s):
** GA1
 
** gibberellin 1
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-115]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[PROTON]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[CPD-5661]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''=>''' 1 [[WATER]][c] '''+''' 1 [[NADP]][c] '''+''' 1 [[CPD1F-119]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 H+[c] '''+''' 1 NADPH[c] '''+''' 1 zeinoxanthin[c] '''+''' 1 oxygen[c] '''=>''' 1 H2O[c] '''+''' 1 NADP+[c] '''+''' 1 lutein[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_8]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
* [[PWY-5947]], lutein biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5947 PWY-5947]
 +
** '''3''' reactions found over '''3''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202506 25202506]
+
{{#set: ec number=EC-1.14.99.45}}
* CHEBI:
+
{{#set: gene associated=Tiso_gene_8}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27717 27717]
+
{{#set: in pathway=PWY-5947}}
* LIGAND-CPD:
+
{{#set: reconstruction category=orthology}}
** [http://www.genome.jp/dbget-bin/www_bget?C00859 C00859]
+
{{#set: reconstruction source=orthology-creinhardtii}}
{{#set: smiles=C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC(O)2)([CH](CC3)4)5)(C)))C([O-])=O)))}}
+
{{#set: reconstruction tool=pantograph}}
{{#set: inchi key=InChIKey=JLJLRLWOEMWYQK-SNTJWBGVSA-M}}
+
{{#set: common name=gibberellin A1}}
+
{{#set: molecular weight=347.387    }}
+
{{#set: common name=GA1|gibberellin 1}}
+
{{#set: consumed by=RXN-115}}
+

Latest revision as of 21:24, 21 March 2018

Reaction RXN-5962

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5947, lutein biosynthesis: PWY-5947
    • 3 reactions found over 3 reactions in the full pathway

Reconstruction information

External links