Difference between revisions of "2-ACETO-LACTATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-196 CPD-196] == * smiles: ** CCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-ACETO-LACTATE 2-ACETO-LACTATE] == * smiles: ** CC(=O)C(C)(O)C(=O)[O-] * common name: ** (S)-2...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-ACETO-LACTATE 2-ACETO-LACTATE] == |
* smiles: | * smiles: | ||
− | ** | + | ** CC(=O)C(C)(O)C(=O)[O-] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** (S)-2-acetolactate |
+ | * inchi key: | ||
+ | ** InChIKey=NMDWGEGFJUBKLB-YFKPBYRVSA-M | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 131.108 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** (S)-2-hydroxy-2-methyl-3-oxobutanoate |
− | ** | + | ** α-acetolactate |
+ | ** (2S)-2-hydroxy-2-methyl-3-oxobutanoate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-6081]] |
− | + | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[ACETOLACTSYN-RXN]] |
− | + | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | * [[ | + | * [[ACETOLACTREDUCTOISOM-RXN]] |
− | * [[ | + | * [[RXN-14037]] |
== External links == | == External links == | ||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=13999770 13999770] |
− | * HMDB : | + | * HMDB : HMDB06855 |
* LIGAND-CPD: | * LIGAND-CPD: | ||
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C06010 C06010] |
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.19951073.html 19951073] | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58476 58476] |
− | * | + | * BIGG : alac__S |
− | {{#set: smiles= | + | {{#set: smiles=CC(=O)C(C)(O)C(=O)[O-]}} |
− | {{#set: | + | {{#set: common name=(S)-2-acetolactate}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=NMDWGEGFJUBKLB-YFKPBYRVSA-M}} |
− | {{#set: molecular weight= | + | {{#set: molecular weight=131.108 }} |
− | {{#set: common name= | + | {{#set: common name=(S)-2-hydroxy-2-methyl-3-oxobutanoate|α-acetolactate|(2S)-2-hydroxy-2-methyl-3-oxobutanoate}} |
− | {{#set: consumed by=RXN- | + | {{#set: consumed by=RXN-6081}} |
− | {{#set: produced by= | + | {{#set: produced by=ACETOLACTSYN-RXN}} |
− | {{#set: | + | {{#set: reversible reaction associated=ACETOLACTREDUCTOISOM-RXN|RXN-14037}} |
Latest revision as of 20:24, 21 March 2018
Contents
Metabolite 2-ACETO-LACTATE
- smiles:
- CC(=O)C(C)(O)C(=O)[O-]
- common name:
- (S)-2-acetolactate
- inchi key:
- InChIKey=NMDWGEGFJUBKLB-YFKPBYRVSA-M
- molecular weight:
- 131.108
- Synonym(s):
- (S)-2-hydroxy-2-methyl-3-oxobutanoate
- α-acetolactate
- (2S)-2-hydroxy-2-methyl-3-oxobutanoate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
- HMDB : HMDB06855
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- BIGG : alac__S
"CC(=O)C(C)(O)C(=O)[O-" cannot be used as a page name in this wiki.