Difference between revisions of "MG-PROTOPORPHYRIN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_8653 == * left end position: ** 2429 * transcription direction: ** POSITIVE * right end position: ** 5209 * centisome position: ** 24.27058...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MG-PROTOPORPHYRIN MG-PROTOPORPHYRIN] == * smiles: ** C=CC2(C(C)=C4(C=C8(C(C)=C(CCC(=O)[O-])C7(=...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_8653 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MG-PROTOPORPHYRIN MG-PROTOPORPHYRIN] ==
* left end position:
+
* smiles:
** 2429
+
** C=CC2(C(C)=C4(C=C8(C(C)=C(CCC(=O)[O-])C7(=N([Mg]35(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C6(C(C)=C(CCC(=O)[O-])C(N56)=C7))))8))))
* transcription direction:
+
* common name:
** POSITIVE
+
** Mg-protoporphyrin
* right end position:
+
* molecular weight:
** 5209
+
** 582.94    
* centisome position:
+
** 24.270584    
+
 
* Synonym(s):
 
* Synonym(s):
 +
** Mg-protoporphyrin IX
 +
** magnesium protoporphyrin
 +
** MgP
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[IPPISOM-RXN]]
+
* [[RXN-MG-PROTOPORPHYRIN-METHYLESTER-SYN]]
** in-silico_annotation
+
== Reaction(s) known to produce the compound ==
***ec-number
+
* [[RXN1F-20]]
== Pathways associated ==
+
== Reaction(s) of unknown directionality ==
* [[PWY-6174]]
+
* [[PWY-7560]]
+
* [[PWY-6859]]
+
* [[NONMEVIPP-PWY]]
+
* [[PWY-6383]]
+
* [[PWY-7391]]
+
* [[PWY-5123]]
+
* [[PWY-922]]
+
* [[PWY-7102]]
+
* [[PWY-7524]]
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=2429}}
+
* PUBCHEM:
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657481 90657481]
{{#set: right end position=5209}}
+
* CHEBI:
{{#set: centisome position=24.270584   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60492 60492]
{{#set: reaction associated=IPPISOM-RXN}}
+
* LIGAND-CPD:
{{#set: pathway associated=PWY-6174|PWY-7560|PWY-6859|NONMEVIPP-PWY|PWY-6383|PWY-7391|PWY-5123|PWY-922|PWY-7102|PWY-7524}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C03516 C03516]
 +
{{#set: smiles=C=CC2(C(C)=C4(C=C8(C(C)=C(CCC(=O)[O-])C7(=N([Mg]35(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C6(C(C)=C(CCC(=O)[O-])C(N56)=C7))))8))))}}
 +
{{#set: common name=Mg-protoporphyrin}}
 +
{{#set: molecular weight=582.94   }}
 +
{{#set: common name=Mg-protoporphyrin IX|magnesium protoporphyrin|MgP}}
 +
{{#set: consumed by=RXN-MG-PROTOPORPHYRIN-METHYLESTER-SYN}}
 +
{{#set: produced by=RXN1F-20}}

Latest revision as of 21:24, 21 March 2018

Metabolite MG-PROTOPORPHYRIN

  • smiles:
    • C=CC2(C(C)=C4(C=C8(C(C)=C(CCC(=O)[O-])C7(=N([Mg]35(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C6(C(C)=C(CCC(=O)[O-])C(N56)=C7))))8))))
  • common name:
    • Mg-protoporphyrin
  • molecular weight:
    • 582.94
  • Synonym(s):
    • Mg-protoporphyrin IX
    • magnesium protoporphyrin
    • MgP

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=CC2(C(C)=C4(C=C8(C(C)=C(CCC(=O)[O-])C7(=N([Mg]35(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C6(C(C)=C(CCC(=O)[O-])C(N56)=C7))))8))))" cannot be used as a page name in this wiki.