Difference between revisions of "CPD-17387"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AICAR AICAR] == * smiles: ** C(OP(=O)([O-])[O-])C1(C(O)C(O)C(O1)N2(C=NC(C(=O)N)=C(N)2)) * inchi...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17387 CPD-17387] == * smiles: ** CCC=CCC=CCC=CCC=CCC=CCC=CCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17387 CPD-17387] == |
* smiles: | * smiles: | ||
− | ** C(OP(=O)([O-])[O-] | + | ** CCC=CCC=CCC=CCC=CCC=CCC=CCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** (3S)-hydroxy-(6Z,9Z,12Z,15Z,18Z,21Z)-tetracosahexaenoyl-CoA |
+ | * inchi key: | ||
+ | ** InChIKey=JJCGUWRDULVWQG-DRXNPIJBSA-J | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 1118.034 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** (3S)-hydroxy-(6Z,9Z,12Z,15Z,18Z,21Z)-tetracosa-6,9,12,15,18,21-hexaenoyl-CoA |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-16136]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-16135]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
− | |||
− | |||
− | |||
== External links == | == External links == | ||
− | |||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=72193742 72193742] |
− | + | ||
− | + | ||
− | + | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=76356 76356] |
− | + | {{#set: smiles=CCC=CCC=CCC=CCC=CCC=CCC=CCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}} | |
− | {{#set: smiles=C(OP(=O)([O-])[O-] | + | {{#set: common name=(3S)-hydroxy-(6Z,9Z,12Z,15Z,18Z,21Z)-tetracosahexaenoyl-CoA}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=JJCGUWRDULVWQG-DRXNPIJBSA-J}} |
− | {{#set: | + | {{#set: molecular weight=1118.034 }} |
− | {{#set: molecular weight= | + | {{#set: common name=(3S)-hydroxy-(6Z,9Z,12Z,15Z,18Z,21Z)-tetracosa-6,9,12,15,18,21-hexaenoyl-CoA}} |
− | {{#set: common name= | + | {{#set: consumed by=RXN-16136}} |
− | {{#set: consumed by= | + | {{#set: produced by=RXN-16135}} |
− | + | ||
− | {{#set: | + |
Latest revision as of 20:25, 21 March 2018
Contents
Metabolite CPD-17387
- smiles:
- CCC=CCC=CCC=CCC=CCC=CCC=CCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
- common name:
- (3S)-hydroxy-(6Z,9Z,12Z,15Z,18Z,21Z)-tetracosahexaenoyl-CoA
- inchi key:
- InChIKey=JJCGUWRDULVWQG-DRXNPIJBSA-J
- molecular weight:
- 1118.034
- Synonym(s):
- (3S)-hydroxy-(6Z,9Z,12Z,15Z,18Z,21Z)-tetracosa-6,9,12,15,18,21-hexaenoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCC=CCC=CCC=CCC=CCC=CCC=CCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O" cannot be used as a page name in this wiki.