Difference between revisions of "RXN1G-193"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-MYO-INOSITOL-34-BISPHOSPHATE D-MYO-INOSITOL-34-BISPHOSPHATE] == * smiles: ** C1(O)(C(O)C(O)C(...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-193 RXN1G-193] == * direction: ** LEFT-TO-RIGHT * common name: ** trans-delta2-cis,cis-5,17-C...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-MYO-INOSITOL-34-BISPHOSPHATE D-MYO-INOSITOL-34-BISPHOSPHATE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-193 RXN1G-193] ==
−
* smiles:
+
* direction:
−
** C1(O)(C(O)C(O)C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])C(O)1)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=MCKAJXMRULSUKI-CNWJWELYSA-J
+
 
* common name:
 
* common name:
−
** D-myo-inositol (3,4)-bisphosphate
+
** trans-delta2-cis,cis-5,17-C36:3-[acyl-carrier protein] reductase
−
* molecular weight:
+
* ec number:
−
** 336.085   
+
** [http://enzyme.expasy.org/EC/1.3.1.M4 EC-1.3.1.M4]
 
* Synonym(s):
 
* Synonym(s):
−
** 1D-myo-inositol (3,4)-bisphosphate
 
−
** inositol (3,4)-bisphosphate
 
−
** (2,3,4,5)-tetrahydroxy-6-phosphonooxy-cyclohexoxy)phosphonic acid
 
−
** Ins(3,4)P2
 
−
** I(3,4)P2
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-10960]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[trans-D2-cis-cis-D5-17-C36-3-ACPs]][c] '''+''' 1 [[NADH]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[cis-cis-D5-17-C36-2-ACPs]][c] '''+''' 1 [[NAD]][c]
−
* [[RXN-10939]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 a trans-delta2-cis,cis-5,17-C36:3-[acp][c] '''+''' 1 NADH[c] '''+''' 1 H+[c] '''=>''' 1 a cis,cis-delta5,17-C36:2-[acp][c] '''+''' 1 NAD+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_10778]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
* [[PWYG-321]], mycolate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWYG-321 PWYG-321]
 +
** '''86''' reactions found over '''182''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21120281 21120281]
+
{{#set: common name=trans-delta2-cis,cis-5,17-C36:3-[acyl-carrier protein] reductase}}
−
* CHEMSPIDER:
+
{{#set: ec number=EC-1.3.1.M4}}
−
** [http://www.chemspider.com/Chemical-Structure.19980559.html 19980559]
+
{{#set: gene associated=Tiso_gene_10778}}
−
* CHEBI:
+
{{#set: in pathway=PWYG-321}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=83241 83241]
+
{{#set: reconstruction category=orthology}}
−
* LIGAND-CPD:
+
{{#set: reconstruction source=orthology-esiliculosus}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C04063 C04063]
+
{{#set: reconstruction tool=pantograph}}
−
* HMDB : HMDB06235
+
−
{{#set: smiles=C1(O)(C(O)C(O)C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])C(O)1)}}
+
−
{{#set: inchi key=InChIKey=MCKAJXMRULSUKI-CNWJWELYSA-J}}
+
−
{{#set: common name=D-myo-inositol (3,4)-bisphosphate}}
+
−
{{#set: molecular weight=336.085    }}
+
−
{{#set: common name=1D-myo-inositol (3,4)-bisphosphate|inositol (3,4)-bisphosphate|(2,3,4,5)-tetrahydroxy-6-phosphonooxy-cyclohexoxy)phosphonic acid|Ins(3,4)P2|I(3,4)P2}}
+
−
{{#set: consumed by=RXN-10960}}
+
−
{{#set: produced by=RXN-10939}}
+

Latest revision as of 20:25, 21 March 2018

Reaction RXN1G-193

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • trans-delta2-cis,cis-5,17-C36:3-[acyl-carrier protein] reductase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWYG-321, mycolate biosynthesis: PWYG-321
    • 86 reactions found over 182 reactions in the full pathway

Reconstruction information

External links

"trans-delta2-cis,cis-5,17-C36:3-[acyl-carrier protein] reductase" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN1G-193&oldid=48570"