Difference between revisions of "TROPINE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15979 CPD-15979] == * common name: ** D-mannopyranose 6-phosphate * Synonym(s): ** D-mannop...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TROPINE TROPINE] == * smiles: ** C[N+]1(C2(CCC1CC(O)C2)) * common name: ** tropine * inchi key:...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TROPINE TROPINE] == |
| + | * smiles: | ||
| + | ** C[N+]1(C2(CCC1CC(O)C2)) | ||
* common name: | * common name: | ||
| − | ** | + | ** tropine |
| + | * inchi key: | ||
| + | ** InChIKey=CYHOMWAPJJPNMW-JIGDXULJSA-O | ||
| + | * molecular weight: | ||
| + | ** 142.22 | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[TROPINESTERASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | * [[ | + | * [[TROPINE-DEHYDROGENASE-RXN]] |
== External links == | == External links == | ||
| − | {{#set: | + | * CAS : 120-29-6 |
| − | {{#set: common name= | + | * LIGAND-CPD: |
| − | {{#set: produced by= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00729 C00729] |
| − | {{#set: | + | * CHEBI: |
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57554 57554] | ||
| + | * NCI: | ||
| + | ** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=43870 43870] | ||
| + | {{#set: smiles=C[N+]1(C2(CCC1CC(O)C2))}} | ||
| + | {{#set: common name=tropine}} | ||
| + | {{#set: inchi key=InChIKey=CYHOMWAPJJPNMW-JIGDXULJSA-O}} | ||
| + | {{#set: molecular weight=142.22 }} | ||
| + | {{#set: produced by=TROPINESTERASE-RXN}} | ||
| + | {{#set: reversible reaction associated=TROPINE-DEHYDROGENASE-RXN}} | ||
Latest revision as of 20:25, 21 March 2018
Contents
Metabolite TROPINE
- smiles:
- C[N+]1(C2(CCC1CC(O)C2))
- common name:
- tropine
- inchi key:
- InChIKey=CYHOMWAPJJPNMW-JIGDXULJSA-O
- molecular weight:
- 142.22
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C[N+]1(C2(CCC1CC(O)C2))" cannot be used as a page name in this wiki.
