Difference between revisions of "Tiso gene 13355"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-702 CPD-702] == * smiles: ** C(O)C1(C=CC(=CC=1)[N+]([O-])=O) * inchi key: ** InChIKey=JKTYG...")
(Created page with "Category:Gene == Gene Tiso_gene_13355 == * Synonym(s): == Reactions associated == * Reaction: RXN-11046 ** Source: orthology-esiliculosus * Reaction: [[RXN-14177]...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-702 CPD-702] ==
+
== Gene Tiso_gene_13355 ==
* smiles:
+
** C(O)C1(C=CC(=CC=1)[N+]([O-])=O)
+
* inchi key:
+
** InChIKey=JKTYGPATCNUWKN-UHFFFAOYSA-N
+
* common name:
+
** 4-nitrobenzyl alcohol
+
* molecular weight:
+
** 153.137   
+
 
* Synonym(s):
 
* Synonym(s):
** 4NBA
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* Reaction: [[RXN-11046]]
* [[RXN0-5141]]
+
** Source: [[orthology-esiliculosus]]
== Reaction(s) of unknown directionality ==
+
* Reaction: [[RXN-14177]]
 +
** Source: [[orthology-athaliana]]
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
* CAS : 619-73-8
+
{{#set: reaction associated=RXN-11046|RXN-14177}}
* PUBCHEM:
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=69275 69275]
+
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.13585105.html 13585105]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=41214 41214]
+
* NCI:
+
** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=5389 5389]
+
{{#set: smiles=C(O)C1(C=CC(=CC=1)[N+]([O-])=O)}}
+
{{#set: inchi key=InChIKey=JKTYGPATCNUWKN-UHFFFAOYSA-N}}
+
{{#set: common name=4-nitrobenzyl alcohol}}
+
{{#set: molecular weight=153.137    }}
+
{{#set: common name=4NBA}}
+
{{#set: produced by=RXN0-5141}}
+

Latest revision as of 20:25, 21 March 2018

Gene Tiso_gene_13355

  • Synonym(s):

Reactions associated

Pathways associated

External links