Difference between revisions of "Tiso gene 13355"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-702 CPD-702] == * smiles: ** C(O)C1(C=CC(=CC=1)[N+]([O-])=O) * inchi key: ** InChIKey=JKTYG...") |
(Created page with "Category:Gene == Gene Tiso_gene_13355 == * Synonym(s): == Reactions associated == * Reaction: RXN-11046 ** Source: orthology-esiliculosus * Reaction: [[RXN-14177]...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_13355 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[RXN-11046]] | |
− | * [[ | + | ** Source: [[orthology-esiliculosus]] |
− | == | + | * Reaction: [[RXN-14177]] |
+ | ** Source: [[orthology-athaliana]] | ||
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=RXN-11046|RXN-14177}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + |
Latest revision as of 20:25, 21 March 2018
Gene Tiso_gene_13355
- Synonym(s):
Reactions associated
- Reaction: RXN-11046
- Source: orthology-esiliculosus
- Reaction: RXN-14177
- Source: orthology-athaliana