Difference between revisions of "2-Hydroxy-Fatty-Acids"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HYPOXANTHINE HYPOXANTHINE] == * smiles: ** C1(NC2(=C(N=1)N=CNC(=O)2)) * inchi key: ** InChIKey=...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-Hydroxy-Fatty-Acids 2-Hydroxy-Fatty-Acids] == * common name: ** a (2R)-2-hydroxy fatty acid *...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-Hydroxy-Fatty-Acids 2-Hydroxy-Fatty-Acids] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** a (2R)-2-hydroxy fatty acid |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** 2-OH fatty acid | ||
| + | ** alpha-Hydroxy fatty acid | ||
| + | ** α-OH fatty acid | ||
| + | ** α-hydroxy fatty acid | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | * [[ | + | * [[CERAMIDASE-YEAST-RXN]] |
== External links == | == External links == | ||
| − | + | {{#set: common name=a (2R)-2-hydroxy fatty acid}} | |
| − | + | {{#set: common name=2-OH fatty acid|alpha-Hydroxy fatty acid|α-OH fatty acid|α-hydroxy fatty acid}} | |
| − | + | {{#set: reversible reaction associated=CERAMIDASE-YEAST-RXN}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
Latest revision as of 20:25, 21 March 2018
Contents
Metabolite 2-Hydroxy-Fatty-Acids
- common name:
- a (2R)-2-hydroxy fatty acid
- Synonym(s):
- 2-OH fatty acid
- alpha-Hydroxy fatty acid
- α-OH fatty acid
- α-hydroxy fatty acid
