Difference between revisions of "Initiation-tRNAmet"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TROPINE TROPINE] == * smiles: ** C[N+]1(C2(CCC1CC(O)C2)) * inchi key: ** InChIKey=CYHOMWAPJJPNM...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Initiation-tRNAmet Initiation-tRNAmet] == * common name: ** initiator tRNAmet * Synonym(s): **...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TROPINE TROPINE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Initiation-tRNAmet Initiation-tRNAmet] ==
* smiles:
+
** C[N+]1(C2(CCC1CC(O)C2))
+
* inchi key:
+
** InChIKey=CYHOMWAPJJPNMW-JIGDXULJSA-O
+
 
* common name:
 
* common name:
** tropine
+
** initiator tRNAmet
* molecular weight:
+
** 142.22   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** tRNAfmet
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-16165]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[TROPINESTERASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[TROPINE-DEHYDROGENASE-RXN]]
 
 
== External links  ==
 
== External links  ==
* CAS : 120-29-6
+
{{#set: common name=initiator tRNAmet}}
* LIGAND-CPD:
+
{{#set: common name=tRNAfmet}}
** [http://www.genome.jp/dbget-bin/www_bget?C00729 C00729]
+
{{#set: consumed by=RXN-16165}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57554 57554]
+
* NCI:
+
** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=43870 43870]
+
{{#set: smiles=C[N+]1(C2(CCC1CC(O)C2))}}
+
{{#set: inchi key=InChIKey=CYHOMWAPJJPNMW-JIGDXULJSA-O}}
+
{{#set: common name=tropine}}
+
{{#set: molecular weight=142.22    }}
+
{{#set: produced by=TROPINESTERASE-RXN}}
+
{{#set: consumed or produced by=TROPINE-DEHYDROGENASE-RXN}}
+

Latest revision as of 20:25, 21 March 2018

Metabolite Initiation-tRNAmet

  • common name:
    • initiator tRNAmet
  • Synonym(s):
    • tRNAfmet

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links