Difference between revisions of "RXN-13313"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6746 CPD-6746] == * smiles: ** C1(O)(C(O)C(O)C(OP([O-])([O-])=O)C(O)C(O)1) * inchi key: **...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13313 RXN-13313] == * direction: ** LEFT-TO-RIGHT * common name: ** protein-tyrosine_phosphatas...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13313 RXN-13313] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** protein-tyrosine_phosphatase_mitochondrial_1 |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/3.1.3.27 EC-3.1.3.27] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[CPDQT-520]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[Pi]][c] '''+''' 1 [[CPD-2183]][c] |
− | == | + | * With common name(s): |
+ | ** 1 phosphatidylglycerophosphate (1-octadecenoyl(9Z), 2-palmitoyl)[c] '''+''' 1 H2O[c] '''=>''' 1 phosphate[c] '''+''' 1 1-oleoyl-2-palmitoyl-phosphatidylglycerol[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_18092]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=protein-tyrosine_phosphatase_mitochondrial_1}} | |
− | {{#set: | + | {{#set: ec number=EC-3.1.3.27}} |
− | {{#set: | + | {{#set: gene associated=Tiso_gene_18092}} |
− | {{#set: | + | {{#set: in pathway=}} |
− | {{#set: | + | {{#set: reconstruction category=annotation}} |
− | {{#set: | + | {{#set: reconstruction source=annotation-experimental_annotation|annotation-in-silico_annotation}} |
− | {{#set: | + | {{#set: reconstruction tool=pathwaytools}} |
Latest revision as of 20:25, 21 March 2018
Contents
Reaction RXN-13313
- direction:
- LEFT-TO-RIGHT
- common name:
- protein-tyrosine_phosphatase_mitochondrial_1
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 phosphatidylglycerophosphate (1-octadecenoyl(9Z), 2-palmitoyl)[c] + 1 H2O[c] => 1 phosphate[c] + 1 1-oleoyl-2-palmitoyl-phosphatidylglycerol[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_18092
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-experimental_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-experimental_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-experimental_annotation