Difference between revisions of "EGMEACPR"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1107 CPD-1107] == * smiles: ** C1(O)(C(OP([O-])([O-])=O)C(OP([O-])(=O)[O-])C(OP([O-])(=O)[O...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=EGMEACPR EGMEACPR] == * direction: ** LEFT-TO-RIGHT * common name: ** Enoylglutaryl-[ACP] methyl es...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1107 CPD-1107] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=EGMEACPR EGMEACPR] ==
−
* smiles:
+
* direction:
−
** C1(O)(C(OP([O-])([O-])=O)C(OP([O-])(=O)[O-])C(OP([O-])(=O)[O-])C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])1)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=CTPQAXVNYGZUAJ-KXXVROSKSA-D
+
 
* common name:
 
* common name:
−
** D-myo-inositol 1,3,4,5,6-pentakisphosphate
+
** Enoylglutaryl-[ACP] methyl ester reductase
−
* molecular weight:
+
−
** 569.977   
+
 
* Synonym(s):
 
* Synonym(s):
−
** Ins(1,3,4,5,6)P5
 
−
** 1D-myo-inositol 1,3,4,5,6-pentakisphosphate
 
−
** inositol 1,3,4,5,6-pentakisphosphate
 
−
** I(1,3,4,5,6)P5
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-10955]]
+
* With identifiers:
−
* [[RXN-7163]]
+
** 1.0 [[NADPH]][m] '''+''' 1.0 [[PROTON]][m] '''+''' 1.0 [[Enoylglutaryl-ACP-methyl-esters]][m] '''=>''' 1.0 [[Glutaryl-ACP-methyl-esters]][m] '''+''' 1.0 [[NADP]][m]
−
== Reaction(s) known to produce the compound ==
+
* With common name(s):
−
* [[2.7.1.134-RXN]]
+
** 1.0 NADPH[m] '''+''' 1.0 H+[m] '''+''' 1.0 an enoylglutaryl-[acp] methyl ester[m] '''=>''' 1.0 a glutaryl-[acp] methyl ester[m] '''+''' 1.0 NADP+[m]
−
* [[2.7.1.140-RXN]]
+
 
−
== Reaction(s) of unknown directionality ==
+
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_10778]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01284 C01284]
+
{{#set: common name=Enoylglutaryl-[ACP] methyl ester reductase}}
−
* CHEBI:
+
{{#set: gene associated=Tiso_gene_10778}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27570 27570]
+
{{#set: in pathway=}}
−
* METABOLIGHTS : MTBLC57733
+
{{#set: reconstruction category=orthology}}
−
* HMDB : HMDB03529
+
{{#set: reconstruction source=orthology-creinhardtii}}
−
{{#set: smiles=C1(O)(C(OP([O-])([O-])=O)C(OP([O-])(=O)[O-])C(OP([O-])(=O)[O-])C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])1)}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: inchi key=InChIKey=CTPQAXVNYGZUAJ-KXXVROSKSA-D}}
+
−
{{#set: common name=D-myo-inositol 1,3,4,5,6-pentakisphosphate}}
+
−
{{#set: molecular weight=569.977    }}
+
−
{{#set: common name=Ins(1,3,4,5,6)P5|1D-myo-inositol 1,3,4,5,6-pentakisphosphate|inositol 1,3,4,5,6-pentakisphosphate|I(1,3,4,5,6)P5}}
+
−
{{#set: consumed by=RXN-10955|RXN-7163}}
+
−
{{#set: produced by=2.7.1.134-RXN|2.7.1.140-RXN}}
+

Latest revision as of 21:25, 21 March 2018

Reaction EGMEACPR

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • Enoylglutaryl-[ACP] methyl ester reductase
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

"Enoylglutaryl-[ACP] methyl ester reductase" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=EGMEACPR&oldid=48633"