Difference between revisions of "RXN-7979"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GMP GMP] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(N)=NC=23))) * inch...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7979 RXN-7979] == * direction: ** LEFT-TO-RIGHT * Synonym(s): ** Zea-epoxidase == Reaction For...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GMP GMP] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7979 RXN-7979] ==
−
* smiles:
+
* direction:
−
** C(OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=RQFCJASXJCIDSX-UUOKFMHZSA-L
+
−
* common name:
+
−
** GMP
+
−
* molecular weight:
+
−
** 361.207   
+
 
* Synonym(s):
 
* Synonym(s):
−
** guanylate
+
** Zea-epoxidase
−
** guanylic acid
+
−
** guanosine phosphate
+
−
** guanosine 5'-phosphate
+
−
** guanosine monophosphate
+
−
** guanosine-5'-monophosphate
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[GMP-REDUCT-RXN]]
+
* With identifiers:
−
* [[GUANYL-KIN-RXN]]
+
** 2 [[PROTON]][c] '''+''' 2 [[Reduced-ferredoxins]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[CPD1F-131]][c] '''=>''' 1 [[CPD1F-133]][c] '''+''' 1 [[WATER]][c] '''+''' 2 [[Oxidized-ferredoxins]][c]
−
* [[AGPTf]]
+
* With common name(s):
−
* [[AGPT]]
+
** 2 H+[c] '''+''' 2 a reduced ferredoxin [iron-sulfur] cluster[c] '''+''' 1 oxygen[c] '''+''' 1 antheraxanthin[c] '''=>''' 1 violaxanthin[c] '''+''' 1 H2O[c] '''+''' 2 an oxidized ferredoxin [iron-sulfur] cluster[c]
−
* [[RXN-7609]]
+
 
−
== Reaction(s) known to produce the compound ==
+
== Genes associated with this reaction  ==
−
* [[RXN-14140]]
+
Genes have been associated with this reaction based on different elements listed below.
−
* [[GMP-SYN-GLUT-RXN]]
+
* Gene: [[Tiso_gene_10919]]
−
* [[GDPA]]
+
** Source: [[orthology-esiliculosus]]
−
* [[NTDP]]
+
== Pathways  ==
−
* [[GMP-SYN-NH3-RXN]]
+
* [[PWY-5945]], zeaxanthin, antheraxanthin and violaxanthin interconversion: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5945 PWY-5945]
−
* [[RXN-14201]]
+
** '''4''' reactions found over '''4''' reactions in the full pathway
−
* [[GUANOSINE-DIPHOSPHATASE-RXN]]
+
* [[PWY-5174]], capsanthin and capsorubin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5174 PWY-5174]
−
* [[35-CYCLIC-GMP-PHOSPHODIESTERASE-RXN]]
+
** '''1''' reactions found over '''3''' reactions in the full pathway
−
== Reaction(s) of unknown directionality ==
+
== Reconstruction information  ==
−
* [[COBALAMINSYN-RXN]]
+
* Category: [[orthology]]
−
* [[GUANPRIBOSYLTRAN-RXN]]
+
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* CAS : 85-32-5
+
* LIGAND-RXN:
−
* METABOLIGHTS : MTBLC58115
+
** [http://www.genome.jp/dbget-bin/www_bget?R07200 R07200]
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=1807035 1807035]
+
{{#set: common name=Zea-epoxidase}}
−
* HMDB : HMDB01397
+
{{#set: gene associated=Tiso_gene_10919}}
−
* LIGAND-CPD:
+
{{#set: in pathway=PWY-5945|PWY-5174}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00144 C00144]
+
{{#set: reconstruction category=orthology}}
−
* CHEMSPIDER:
+
{{#set: reconstruction source=orthology-esiliculosus}}
−
** [http://www.chemspider.com/Chemical-Structure.1413162.html 1413162]
+
{{#set: reconstruction tool=pantograph}}
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58115 58115]
+
−
* BIGG : gmp
+
−
{{#set: smiles=C(OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))}}
+
−
{{#set: inchi key=InChIKey=RQFCJASXJCIDSX-UUOKFMHZSA-L}}
+
−
{{#set: common name=GMP}}
+
−
{{#set: molecular weight=361.207    }}
+
−
{{#set: common name=guanylate|guanylic acid|guanosine phosphate|guanosine 5'-phosphate|guanosine monophosphate|guanosine-5'-monophosphate}}
+
−
{{#set: consumed by=GMP-REDUCT-RXN|GUANYL-KIN-RXN|AGPTf|AGPT|RXN-7609}}
+
−
{{#set: produced by=RXN-14140|GMP-SYN-GLUT-RXN|GDPA|NTDP|GMP-SYN-NH3-RXN|RXN-14201|GUANOSINE-DIPHOSPHATASE-RXN|35-CYCLIC-GMP-PHOSPHODIESTERASE-RXN}}
+
−
{{#set: consumed or produced by=COBALAMINSYN-RXN|GUANPRIBOSYLTRAN-RXN}}
+

Latest revision as of 19:22, 21 March 2018

Reaction RXN-7979

  • direction:
    • LEFT-TO-RIGHT
  • Synonym(s):
    • Zea-epoxidase

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5945, zeaxanthin, antheraxanthin and violaxanthin interconversion: PWY-5945
    • 4 reactions found over 4 reactions in the full pathway
  • PWY-5174, capsanthin and capsorubin biosynthesis: PWY-5174
    • 1 reactions found over 3 reactions in the full pathway

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-7979&oldid=41159"