Difference between revisions of "CANAVANINE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CANAVANINE CANAVANINE] == * smiles: ** C(CC([N+])C(=O)[O-])ONC(=[N+])N * common name: ** L-cana...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6538 PWY-6538] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CANAVANINE CANAVANINE] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
+
** C(CC([N+])C(=O)[O-])ONC(=[N+])N
 
* common name:
 
* common name:
** caffeine degradation III (bacteria, via demethylation)
+
** L-canavanine
 +
* inchi key:
 +
** InChIKey=FSBIGDSBMBYOPN-VKHMYHEASA-O
 +
* molecular weight:
 +
** 177.183   
 
* Synonym(s):
 
* Synonym(s):
** caffeine degradation (bacteria)
+
** canavanine
 +
** 2-amino-4-(guanidinooxy)butyrate
 +
** 2-amino-4-(guanidinooxy)butyric acid
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
'''2''' reactions found over '''7''' reactions in the full pathway
+
== Reaction(s) known to produce the compound ==
* [[RXN0-901]]
+
* [[RXN-22]]
* [[XANTHINE-OXIDASE-RXN]]
+
== Reaction(s) of unknown directionality ==
== Reaction(s) not found ==
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11513 RXN-11513]
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11516 RXN-11516]
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11517 RXN-11517]
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11518 RXN-11518]
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-13106 RXN-13106]
+
 
== External links  ==
 
== External links  ==
* LIGAND-MAP:
+
* CAS : 543-38-4
** [http://www.genome.jp/dbget-bin/www_bget?map00232 map00232]
+
* PUBCHEM:
* UM-BBD-PWY : caf
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=36688185 36688185]
{{#set: taxonomic range=TAX-2}}
+
* HMDB : HMDB02706
{{#set: common name=caffeine degradation III (bacteria, via demethylation)}}
+
* CHEBI:
{{#set: common name=caffeine degradation (bacteria)}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=78902 78902]
{{#set: reaction found=2}}
+
* LIGAND-CPD:
{{#set: reaction not found=7}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C00308 C00308]
{{#set: completion rate=29.0}}
+
{{#set: smiles=C(CC([N+])C(=O)[O-])ONC(=[N+])N}}
 +
{{#set: common name=L-canavanine}}
 +
{{#set: inchi key=InChIKey=FSBIGDSBMBYOPN-VKHMYHEASA-O}}
 +
{{#set: molecular weight=177.183    }}
 +
{{#set: common name=canavanine|2-amino-4-(guanidinooxy)butyrate|2-amino-4-(guanidinooxy)butyric acid}}
 +
{{#set: produced by=RXN-22}}

Latest revision as of 19:08, 21 March 2018

Metabolite CANAVANINE

  • smiles:
    • C(CC([N+])C(=O)[O-])ONC(=[N+])N
  • common name:
    • L-canavanine
  • inchi key:
    • InChIKey=FSBIGDSBMBYOPN-VKHMYHEASA-O
  • molecular weight:
    • 177.183
  • Synonym(s):
    • canavanine
    • 2-amino-4-(guanidinooxy)butyrate
    • 2-amino-4-(guanidinooxy)butyric acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(CC([N+])C(=O)[O-])ONC(=[N+])N" cannot be used as a page name in this wiki.