Difference between revisions of "CPD-12177"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12177 CPD-12177] == * smiles: ** CC([CH]=O)C(=O)[O-] * common name: ** (R)-methylmalonate-s...") |
|||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12177 CPD-12177] == |
| − | * | + | * smiles: |
| − | ** [ | + | ** CC([CH]=O)C(=O)[O-] |
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** (R)-methylmalonate-semialdehyde |
| + | * inchi key: | ||
| + | ** InChIKey=VOKUMXABRRXHAR-GSVOUGTGSA-M | ||
| + | * molecular weight: | ||
| + | ** 101.082 | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** (R)-2-methyl-3-oxopropanoate |
| + | ** (R)-ch3-malonate-semialdehyde | ||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == Reaction(s) | + | * [[RXN-14056]] |
| − | + | ||
| − | + | ||
| − | + | ||
| − | * [ | + | |
| − | + | ||
== External links == | == External links == | ||
| − | + | * PUBCHEM: | |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173310 46173310] |
| − | {{#set: common name= | + | {{#set: smiles=CC([CH]=O)C(=O)[O-]}} |
| − | {{#set: | + | {{#set: common name=(R)-methylmalonate-semialdehyde}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=VOKUMXABRRXHAR-GSVOUGTGSA-M}} |
| − | {{#set: | + | {{#set: molecular weight=101.082 }} |
| − | {{#set: | + | {{#set: common name=(R)-2-methyl-3-oxopropanoate|(R)-ch3-malonate-semialdehyde}} |
| + | {{#set: reversible reaction associated=RXN-14056}} | ||
Latest revision as of 19:09, 21 March 2018
Contents
Metabolite CPD-12177
- smiles:
- CC([CH]=O)C(=O)[O-]
- common name:
- (R)-methylmalonate-semialdehyde
- inchi key:
- InChIKey=VOKUMXABRRXHAR-GSVOUGTGSA-M
- molecular weight:
- 101.082
- Synonym(s):
- (R)-2-methyl-3-oxopropanoate
- (R)-ch3-malonate-semialdehyde
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CC([CH]=O)C(=O)[O-" cannot be used as a page name in this wiki.
