Difference between revisions of "URATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ARG ARG] == * smiles: ** C(NC(N)=[N+])CCC([N+])C(=O)[O-] * inchi key: ** InChIKey=ODKSFYDXXFIFQ...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=URATE URATE] == * smiles: ** C12(NC(=O)NC=1C(=O)NC(=O)N2) * common name: ** urate * inchi key:...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=URATE URATE] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C12(NC(=O)NC=1C(=O)NC(=O)N2) |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** urate |
| + | * inchi key: | ||
| + | ** InChIKey=LEHOTFFKMJEONL-UHFFFAOYSA-N | ||
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 168.112 |
* Synonym(s): | * Synonym(s): | ||
| − | ** 2- | + | ** 2,6,8-trioxypurine |
| − | ** | + | ** purine-2,6,8-(1H,3H,9H)-trione |
| − | ** | + | ** 7,9-dihydro-1H-purine-2,6,8(3H)-trione |
| − | + | ||
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[XANTHINE-OXIDASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | * [[ | + | * [[URATEtm]] |
| − | * [[ | + | * [[RXN0-901]] |
| + | * [[URATEt]] | ||
== External links == | == External links == | ||
| − | * CAS : | + | * CAS : 69-93-2 |
| − | * | + | * Wikipedia : Uric_acid |
| + | * BIGG : urate | ||
| + | * DRUGBANK : DB01696 | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44229235 44229235] |
| − | * HMDB : | + | * HMDB : HMDB00289 |
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00366 C00366] |
| − | + | ||
| − | + | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17775 17775] |
| − | * | + | * METABOLIGHTS : MTBLC17775 |
| − | {{#set: smiles= | + | {{#set: smiles=C12(NC(=O)NC=1C(=O)NC(=O)N2)}} |
| − | {{#set: | + | {{#set: common name=urate}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=LEHOTFFKMJEONL-UHFFFAOYSA-N}} |
| − | {{#set: molecular weight= | + | {{#set: molecular weight=168.112 }} |
| − | {{#set: common name=2- | + | {{#set: common name=2,6,8-trioxypurine|purine-2,6,8-(1H,3H,9H)-trione|7,9-dihydro-1H-purine-2,6,8(3H)-trione}} |
| − | {{#set: | + | {{#set: produced by=XANTHINE-OXIDASE-RXN}} |
| − | {{#set: | + | {{#set: reversible reaction associated=URATEtm|RXN0-901|URATEt}} |
Latest revision as of 19:22, 21 March 2018
Contents
Metabolite URATE
- smiles:
- C12(NC(=O)NC=1C(=O)NC(=O)N2)
- common name:
- urate
- inchi key:
- InChIKey=LEHOTFFKMJEONL-UHFFFAOYSA-N
- molecular weight:
- 168.112
- Synonym(s):
- 2,6,8-trioxypurine
- purine-2,6,8-(1H,3H,9H)-trione
- 7,9-dihydro-1H-purine-2,6,8(3H)-trione
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 69-93-2
- Wikipedia : Uric_acid
- BIGG : urate
- DRUGBANK : DB01696
- PUBCHEM:
- HMDB : HMDB00289
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC17775
