Difference between revisions of "CPD-3483"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3483 CPD-3483] == * smiles: ** CC([N+]C(C)(C)CO)C(=O)C1(C=CC=C(Cl)C=1) * common name: ** hy...") |
|||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3483 CPD-3483] == |
− | * | + | * smiles: |
− | ** [ | + | ** CC([N+]C(C)(C)CO)C(=O)C1(C=CC=C(Cl)C=1) |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** hydroxybupropion |
+ | * inchi key: | ||
+ | ** InChIKey=AKOAEVOSDHIVFX-UHFFFAOYSA-O | ||
+ | * molecular weight: | ||
+ | ** 256.752 | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | * [[ | + | * [[RXN66-181]] |
− | == Reaction(s) | + | == Reaction(s) of unknown directionality == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | * PUBCHEM: | |
− | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202442 25202442] | |
− | + | * HMDB : HMDB12235 | |
− | {{#set: | + | {{#set: smiles=CC([N+]C(C)(C)CO)C(=O)C1(C=CC=C(Cl)C=1)}} |
− | + | {{#set: common name=hydroxybupropion}} | |
− | {{#set: common name= | + | {{#set: inchi key=InChIKey=AKOAEVOSDHIVFX-UHFFFAOYSA-O}} |
− | {{#set: | + | {{#set: molecular weight=256.752 }} |
− | {{#set: | + | {{#set: produced by=RXN66-181}} |
− | {{#set: | + |
Latest revision as of 20:24, 21 March 2018
Contents
Metabolite CPD-3483
- smiles:
- CC([N+]C(C)(C)CO)C(=O)C1(C=CC=C(Cl)C=1)
- common name:
- hydroxybupropion
- inchi key:
- InChIKey=AKOAEVOSDHIVFX-UHFFFAOYSA-O
- molecular weight:
- 256.752
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
- HMDB : HMDB12235
"CC([N+]C(C)(C)CO)C(=O)C1(C=CC=C(Cl)C=1)" cannot be used as a page name in this wiki.