Difference between revisions of "CPD-11770"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11770 CPD-11770] == * smiles: ** C1(NC2(N=C(N)NC(=O)C(N=C1C(O)C(O)CO)=2)) * common name: **...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7736 PWY-7736] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11770 CPD-11770] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
+
** C1(NC2(N=C(N)NC(=O)C(N=C1C(O)C(O)CO)=2))
 
* common name:
 
* common name:
** stellatic acid biosynthesis
+
** 7,8-dihydromonapterin
 +
* inchi key:
 +
** InChIKey=YQIFAMYNGGOTFB-NJGYIYPDSA-N
 +
* molecular weight:
 +
** 255.233   
 
* Synonym(s):
 
* Synonym(s):
 +
** DHM
 +
** H2-MPt
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
'''3''' reactions found over '''8''' reactions in the full pathway
+
== Reaction(s) known to produce the compound ==
* [[FARNESYLTRANSTRANSFERASE-RXN]]
+
== Reaction(s) of unknown directionality ==
* [[FPPSYN-RXN]]
+
* [[RXN-10857]]
* [[GPPSYN-RXN]]
+
== Reaction(s) not found ==
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-17161 RXN-17161]
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-17162 RXN-17162]
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-17163 RXN-17163]
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-17164 RXN-17164]
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8813 RXN-8813]
+
 
== External links  ==
 
== External links  ==
{{#set: taxonomic range=TAX-4751}}
+
* LIGAND-CPD:
{{#set: common name=stellatic acid biosynthesis}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C21008 C21008]
{{#set: reaction found=3}}
+
* CHEBI:
{{#set: reaction not found=8}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71175 71175]
{{#set: completion rate=38.0}}
+
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45479435 45479435]
 +
{{#set: smiles=C1(NC2(N=C(N)NC(=O)C(N=C1C(O)C(O)CO)=2))}}
 +
{{#set: common name=7,8-dihydromonapterin}}
 +
{{#set: inchi key=InChIKey=YQIFAMYNGGOTFB-NJGYIYPDSA-N}}
 +
{{#set: molecular weight=255.233    }}
 +
{{#set: common name=DHM|H2-MPt}}
 +
{{#set: reversible reaction associated=RXN-10857}}

Latest revision as of 19:24, 21 March 2018

Metabolite CPD-11770

  • smiles:
    • C1(NC2(N=C(N)NC(=O)C(N=C1C(O)C(O)CO)=2))
  • common name:
    • 7,8-dihydromonapterin
  • inchi key:
    • InChIKey=YQIFAMYNGGOTFB-NJGYIYPDSA-N
  • molecular weight:
    • 255.233
  • Synonym(s):
    • DHM
    • H2-MPt

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links