Difference between revisions of "CPD-19170"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19170 CPD-19170] == * smiles: ** CCCCCCCCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5076 PWY-5076] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19170 CPD-19170] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
+
** CCCCCCCCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
 
* common name:
 
* common name:
** L-leucine degradation III
+
** (2E,7Z)-hexadecenoyl-CoA
 +
* inchi key:
 +
** InChIKey=YQARRKBGBKPBCX-DVZFGLDUSA-J
 +
* molecular weight:
 +
** 997.883   
 
* Synonym(s):
 
* Synonym(s):
** Ehrlich pathway
+
** 16:2-Δ2,Δ7-CoA
 +
** 2-trans,7-cis-hexadecenoyl-CoA
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
'''2''' reactions found over '''3''' reactions in the full pathway
+
== Reaction(s) known to produce the compound ==
* [[BRANCHED-CHAINAMINOTRANSFERLEU-RXN]]
+
* [[RXN-17779]]
* [[RXN-7693]]
+
== Reaction(s) of unknown directionality ==
== Reaction(s) not found ==
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-7692 RXN-7692]
+
 
== External links  ==
 
== External links  ==
{{#set: taxonomic range=TAX-4751}}
+
{{#set: smiles=CCCCCCCCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
{{#set: common name=L-leucine degradation III}}
+
{{#set: common name=(2E,7Z)-hexadecenoyl-CoA}}
{{#set: common name=Ehrlich pathway}}
+
{{#set: inchi key=InChIKey=YQARRKBGBKPBCX-DVZFGLDUSA-J}}
{{#set: reaction found=2}}
+
{{#set: molecular weight=997.883    }}
{{#set: reaction not found=3}}
+
{{#set: common name=16:2-Δ2,Δ7-CoA|2-trans,7-cis-hexadecenoyl-CoA}}
{{#set: completion rate=67.0}}
+
{{#set: produced by=RXN-17779}}

Latest revision as of 19:26, 21 March 2018

Metabolite CPD-19170

  • smiles:
    • CCCCCCCCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • common name:
    • (2E,7Z)-hexadecenoyl-CoA
  • inchi key:
    • InChIKey=YQARRKBGBKPBCX-DVZFGLDUSA-J
  • molecular weight:
    • 997.883
  • Synonym(s):
    • 16:2-Δ2,Δ7-CoA
    • 2-trans,7-cis-hexadecenoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCCCC=CCCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.