Difference between revisions of "CPD0-1028"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1028 CPD0-1028] == * smiles: ** CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-]...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7724 PWY-7724] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1028 CPD0-1028] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-33208]
+
** CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-])C
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
+
 
* common name:
 
* common name:
** icosapentaenoate biosynthesis III (8-desaturase, mammals)
+
** 2-cis,6-trans,10-trans-geranylgeranyl diphosphate
 +
* inchi key:
 +
** InChIKey=OINNEUNVOZHBOX-KWBDAJKESA-K
 +
* molecular weight:
 +
** 447.424   
 
* Synonym(s):
 
* Synonym(s):
** eicosapentaenoic acid biosynthesis III
+
** di-trans,poly-cis-geranylgeranyl diphosphate
** eicosapentaenoate biosynthesis III (metazoa)
+
** ω,E,E,Z-geranylgeranyl diphosphate
** iicosapentaenoic acid biosynthesis III
+
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
'''5''' reactions found over '''7''' reactions in the full pathway
+
== Reaction(s) known to produce the compound ==
* [[LINOLENOYL-RXN]]
+
== Reaction(s) of unknown directionality ==
* [[RXN-12994]]
+
* [[RXN-13323]]
* [[RXN-12997]]
+
* [[RXN0-5180]]
* [[RXN-13001]]
+
* [[RXN-13441]]
+
== Reaction(s) not found ==
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-13429 RXN-13429]
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-17106 RXN-17106]
+
 
== External links  ==
 
== External links  ==
{{#set: taxonomic range=TAX-33208}}
+
* PUBCHEM:
{{#set: taxonomic range=TAX-4751}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245826 25245826]
{{#set: common name=icosapentaenoate biosynthesis III (8-desaturase, mammals)}}
+
* CHEBI:
{{#set: common name=eicosapentaenoic acid biosynthesis III|eicosapentaenoate biosynthesis III (metazoa)|iicosapentaenoic acid biosynthesis III}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62639 62639]
{{#set: reaction found=5}}
+
* LIGAND-CPD:
{{#set: reaction not found=7}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C11356 C11356]
{{#set: completion rate=71.0}}
+
{{#set: smiles=CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-])C}}
 +
{{#set: common name=2-cis,6-trans,10-trans-geranylgeranyl diphosphate}}
 +
{{#set: inchi key=InChIKey=OINNEUNVOZHBOX-KWBDAJKESA-K}}
 +
{{#set: molecular weight=447.424    }}
 +
{{#set: common name=di-trans,poly-cis-geranylgeranyl diphosphate|ω,E,E,Z-geranylgeranyl diphosphate}}
 +
{{#set: reversible reaction associated=RXN-13323|RXN0-5180}}

Latest revision as of 19:27, 21 March 2018

Metabolite CPD0-1028

  • smiles:
    • CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-])C
  • common name:
    • 2-cis,6-trans,10-trans-geranylgeranyl diphosphate
  • inchi key:
    • InChIKey=OINNEUNVOZHBOX-KWBDAJKESA-K
  • molecular weight:
    • 447.424
  • Synonym(s):
    • di-trans,poly-cis-geranylgeranyl diphosphate
    • ω,E,E,Z-geranylgeranyl diphosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-])C" cannot be used as a page name in this wiki.