Difference between revisions of "CPD0-1028"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1028 CPD0-1028] == * smiles: ** CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-]...") |
|||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1028 CPD0-1028] == |
− | * | + | * smiles: |
− | ** [ | + | ** CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-])C |
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** 2-cis,6-trans,10-trans-geranylgeranyl diphosphate |
+ | * inchi key: | ||
+ | ** InChIKey=OINNEUNVOZHBOX-KWBDAJKESA-K | ||
+ | * molecular weight: | ||
+ | ** 447.424 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** di-trans,poly-cis-geranylgeranyl diphosphate |
− | ** | + | ** ω,E,E,Z-geranylgeranyl diphosphate |
− | + | ||
− | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[RXN-13323]] | |
− | + | * [[RXN0-5180]] | |
− | + | ||
− | + | ||
− | == Reaction(s) | + | |
− | * [ | + | |
− | * [ | + | |
== External links == | == External links == | ||
− | + | * PUBCHEM: | |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245826 25245826] |
− | {{#set: common name= | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62639 62639] |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C11356 C11356] |
− | {{#set: | + | {{#set: smiles=CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-])C}} |
+ | {{#set: common name=2-cis,6-trans,10-trans-geranylgeranyl diphosphate}} | ||
+ | {{#set: inchi key=InChIKey=OINNEUNVOZHBOX-KWBDAJKESA-K}} | ||
+ | {{#set: molecular weight=447.424 }} | ||
+ | {{#set: common name=di-trans,poly-cis-geranylgeranyl diphosphate|ω,E,E,Z-geranylgeranyl diphosphate}} | ||
+ | {{#set: reversible reaction associated=RXN-13323|RXN0-5180}} |
Latest revision as of 20:27, 21 March 2018
Contents
Metabolite CPD0-1028
- smiles:
- CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-])C
- common name:
- 2-cis,6-trans,10-trans-geranylgeranyl diphosphate
- inchi key:
- InChIKey=OINNEUNVOZHBOX-KWBDAJKESA-K
- molecular weight:
- 447.424
- Synonym(s):
- di-trans,poly-cis-geranylgeranyl diphosphate
- ω,E,E,Z-geranylgeranyl diphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-])C" cannot be used as a page name in this wiki.