Difference between revisions of "CPD-8614"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8614 CPD-8614] == * smiles: ** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)C(=O...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5399 PWY-5399] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8614 CPD-8614] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
+
** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)C(=O)CC3)))CC4)))C
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3524 TAX-3524]
+
 
* common name:
 
* common name:
** betacyanin biosynthesis
+
** 4α-methyl-5α-cholesta-8-en-3-one
 +
* inchi key:
 +
** InChIKey=SDZUXFFGOQZLPK-SINUOACOSA-N
 +
* molecular weight:
 +
** 398.671   
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
'''3''' reactions found over '''8''' reactions in the full pathway
+
== Reaction(s) known to produce the compound ==
* [[RXN-13061]]
+
* [[RXN66-18]]
* [[RXN-5861]]
+
== Reaction(s) of unknown directionality ==
* [[RXN-8483]]
+
== Reaction(s) not found ==
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8478 RXN-8478]
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8479 RXN-8479]
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8480 RXN-8480]
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8481 RXN-8481]
+
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-8482 RXN-8482]
+
 
== External links  ==
 
== External links  ==
{{#set: taxonomic range=TAX-4751}}
+
* PUBCHEM:
{{#set: taxonomic range=TAX-3524}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44263323 44263323]
{{#set: common name=betacyanin biosynthesis}}
+
* CHEBI:
{{#set: reaction found=3}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=87050 87050]
{{#set: reaction not found=8}}
+
* HMDB : HMDB12174
{{#set: completion rate=38.0}}
+
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)C(=O)CC3)))CC4)))C}}
 +
{{#set: common name=4α-methyl-5α-cholesta-8-en-3-one}}
 +
{{#set: inchi key=InChIKey=SDZUXFFGOQZLPK-SINUOACOSA-N}}
 +
{{#set: molecular weight=398.671    }}
 +
{{#set: produced by=RXN66-18}}

Latest revision as of 20:27, 21 March 2018

Metabolite CPD-8614

  • smiles:
    • CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)C(=O)CC3)))CC4)))C
  • common name:
    • 4α-methyl-5α-cholesta-8-en-3-one
  • inchi key:
    • InChIKey=SDZUXFFGOQZLPK-SINUOACOSA-N
  • molecular weight:
    • 398.671
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)C(=O)CC3)))CC4)))C" cannot be used as a page name in this wiki.