Difference between revisions of "O-SINAPOYLCHOLINE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=O-SINAPOYLCHOLINE O-SINAPOYLCHOLINE] == * smiles: ** C(COC(=O)C=CC1(C=C(OC)C(O)=C(C=1)OC))[N+](...") |
|||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=O-SINAPOYLCHOLINE O-SINAPOYLCHOLINE] == |
− | * | + | * smiles: |
− | ** | + | ** C(COC(=O)C=CC1(C=C(OC)C(O)=C(C=1)OC))[N+](C)(C)C |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** O-sinapoylcholine |
+ | * inchi key: | ||
+ | ** InChIKey=HUJXHFRXWWGYQH-UHFFFAOYSA-O | ||
+ | * molecular weight: | ||
+ | ** 310.369 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** sinapoylcholine |
+ | ** sinapine | ||
− | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[2.3.1.91-RXN]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | == Reaction(s) | + | |
− | * [ | + | |
− | + | ||
== External links == | == External links == | ||
− | * | + | * CAS : 18696-26-9 |
− | ** [http:// | + | * PUBCHEM: |
− | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5280385 5280385] | |
− | + | * HMDB : HMDB29379 | |
− | {{#set: | + | * CHEBI: |
− | {{#set: common name= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16353 16353] |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00933 C00933] |
− | {{#set: | + | {{#set: smiles=C(COC(=O)C=CC1(C=C(OC)C(O)=C(C=1)OC))[N+](C)(C)C}} |
− | {{#set: | + | {{#set: common name=O-sinapoylcholine}} |
+ | {{#set: inchi key=InChIKey=HUJXHFRXWWGYQH-UHFFFAOYSA-O}} | ||
+ | {{#set: molecular weight=310.369 }} | ||
+ | {{#set: common name=sinapoylcholine|sinapine}} | ||
+ | {{#set: produced by=2.3.1.91-RXN}} |
Latest revision as of 19:28, 21 March 2018
Contents
Metabolite O-SINAPOYLCHOLINE
- smiles:
- C(COC(=O)C=CC1(C=C(OC)C(O)=C(C=1)OC))[N+](C)(C)C
- common name:
- O-sinapoylcholine
- inchi key:
- InChIKey=HUJXHFRXWWGYQH-UHFFFAOYSA-O
- molecular weight:
- 310.369
- Synonym(s):
- sinapoylcholine
- sinapine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(COC(=O)C=CC1(C=C(OC)C(O)=C(C=1)OC))[N+](C)(C)C" cannot be used as a page name in this wiki.