Difference between revisions of "ARG"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ALANINE-AMINOTRANSFERASE-RXN ALANINE-AMINOTRANSFERASE-RXN] == * direction: ** REVERSIBLE * common n...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ARG ARG] == * smiles: ** C(NC(N)=[N+])CCC([N+])C(=O)[O-] * common name: ** L-arginine * inchi k...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ARG ARG] == |
− | * | + | * smiles: |
− | ** | + | ** C(NC(N)=[N+])CCC([N+])C(=O)[O-] |
* common name: | * common name: | ||
− | ** | + | ** L-arginine |
− | ** | + | * inchi key: |
− | * | + | ** InChIKey=ODKSFYDXXFIFQN-BYPYZUCNSA-O |
− | ** | + | * molecular weight: |
+ | ** 175.21 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 2-amino-5-guanidinovaleric acid | ||
+ | ** R | ||
+ | ** arginine | ||
+ | ** arg | ||
+ | ** L-arg | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | * [[ARGININE--TRNA-LIGASE-RXN]] | |
− | + | * [[ARGININE-2-MONOOXYGENASE-RXN]] | |
− | + | * [[RME144]] | |
− | + | * [[1.5.1.19-RXN]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | = | + | == Reaction(s) of unknown directionality == |
− | + | * [[ARGSUCCINLYA-RXN]] | |
− | * [[ | + | * [[ARGINASE-RXN]] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * CAS : 74-79-3 |
− | ** [http:// | + | * BIGG : arg__L |
− | * LIGAND- | + | * PUBCHEM: |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=1549073 1549073] |
− | * | + | * HMDB : HMDB00517 |
− | ** [http://www. | + | * LIGAND-CPD: |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00062 C00062] | |
− | * | + | * CHEMSPIDER: |
− | ** [http://www. | + | ** [http://www.chemspider.com/Chemical-Structure.1266045.html 1266045] |
− | + | * CHEBI: | |
− | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=32682 32682] | |
− | * | + | * METABOLIGHTS : MTBLC32682 |
− | {{#set: | + | {{#set: smiles=C(NC(N)=[N+])CCC([N+])C(=O)[O-]}} |
− | {{#set: common name= | + | {{#set: common name=L-arginine}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=ODKSFYDXXFIFQN-BYPYZUCNSA-O}} |
− | {{#set: | + | {{#set: molecular weight=175.21 }} |
− | {{#set: | + | {{#set: common name=2-amino-5-guanidinovaleric acid|R|arginine|arg|L-arg}} |
− | {{#set: | + | {{#set: consumed by=ARGININE--TRNA-LIGASE-RXN|ARGININE-2-MONOOXYGENASE-RXN|RME144|1.5.1.19-RXN}} |
− | {{#set: | + | {{#set: reversible reaction associated=ARGSUCCINLYA-RXN|ARGINASE-RXN}} |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + |
Latest revision as of 19:22, 21 March 2018
Contents
Metabolite ARG
- smiles:
- C(NC(N)=[N+])CCC([N+])C(=O)[O-]
- common name:
- L-arginine
- inchi key:
- InChIKey=ODKSFYDXXFIFQN-BYPYZUCNSA-O
- molecular weight:
- 175.21
- Synonym(s):
- 2-amino-5-guanidinovaleric acid
- R
- arginine
- arg
- L-arg
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 74-79-3
- BIGG : arg__L
- PUBCHEM:
- HMDB : HMDB00517
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC32682
"C(NC(N)=[N+])CCC([N+])C(=O)[O-" cannot be used as a page name in this wiki.