Difference between revisions of "Tiso gene 7036"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LINOLENIC_ACID LINOLENIC_ACID] == * smiles: ** CCC=CCC=CCC=CCCCCCCCC(=O)[O-] * inchi key: ** In...") |
(Created page with "Category:Gene == Gene Tiso_gene_7036 == * Synonym(s): == Reactions associated == * Reaction: 3.1.3.16-RXN ** Source: annotation-experimental_annotation *** Assign...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_7036 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[3.1.3.16-RXN]] |
− | * [[ | + | ** Source: [[annotation-experimental_annotation]] |
− | * | + | *** Assignment: automated-name-match |
− | + | == Pathways associated == | |
− | * | + | |
− | == | + | |
== External links == | == External links == | ||
− | + | {{#set: reaction associated=3.1.3.16-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + |
Latest revision as of 20:23, 21 March 2018
Gene Tiso_gene_7036
- Synonym(s):
Reactions associated
- Reaction: 3.1.3.16-RXN
- Source: annotation-experimental_annotation
- Assignment: automated-name-match
- Source: annotation-experimental_annotation