Difference between revisions of "Tiso gene 8411"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FARNESYL-PP FARNESYL-PP] == * smiles: ** CC(=CCCC(=CCCC(=CCOP(OP([O-])(=O)[O-])(=O)[O-])C)C)C *...") |
(Created page with "Category:Gene == Gene Tiso_gene_8411 == * Synonym(s): == Reactions associated == * Reaction: 2.4.2.12-RXN ** Source: annotation-in-silico_annotation *** Assignmen...") |
||
(4 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_8411 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[2.4.2.12-RXN]] |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | * [[ | + | *** Assignment: automated-name-match |
− | + | ** Source: [[orthology-creinhardtii]] | |
− | * [[ | + | * Reaction: [[COBALAMINSYN-RXN]] |
− | == | + | ** Source: [[orthology-synechocystis]] |
− | * [[ | + | == Pathways associated == |
− | * [[ | + | * [[NAD-BIOSYNTHESIS-III]] |
+ | * [[PWY-5508]] | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=2.4.2.12-RXN|COBALAMINSYN-RXN}} | |
− | + | {{#set: pathway associated=NAD-BIOSYNTHESIS-III|PWY-5508}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + |
Latest revision as of 20:04, 21 March 2018
Gene Tiso_gene_8411
- Synonym(s):
Reactions associated
- Reaction: 2.4.2.12-RXN
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: orthology-creinhardtii
- Source: annotation-in-silico_annotation
- Reaction: COBALAMINSYN-RXN
- Source: orthology-synechocystis