Difference between revisions of "Tiso gene 18977"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12906 CPD-12906] == * smiles: ** CC(C)=CC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=...")
 
(Created page with "Category:Gene == Gene Tiso_gene_18977 == * right end position: ** 2441 * transcription direction: ** POSITIVE * left end position: ** 13 * centisome position: ** 0.4847129...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12906 CPD-12906] ==
+
== Gene Tiso_gene_18977 ==
−
* smiles:
+
* right end position:
−
** CC(C)=CC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 2441
−
* inchi key:
+
* transcription direction:
−
** InChIKey=ZFKZVSUJTDSJEY-SVHODSNWSA-J
+
** POSITIVE
−
* common name:
+
* left end position:
−
** 5-methyl-3-oxo-4-hexenoyl-CoA
+
** 13
−
* molecular weight:
+
* centisome position:
−
** 887.641    
+
** 0.4847129    
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-11921]]
+
* Reaction: [[4-HYDROXYPHENYLPYRUVATE-DIOXYGENASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-synechocystis]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-10815]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways associated ==
 +
* [[PWY-1581]]
 +
* [[PWY-7432]]
 +
* [[TYRFUMCAT-PWY]]
 +
* [[PWY-1422]]
 +
* [[PWY-6318]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=2441}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50986120 50986120]
+
{{#set: transcription direction=POSITIVE}}
−
* LIGAND-CPD:
+
{{#set: left end position=13}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C16471 C16471]
+
{{#set: centisome position=0.4847129    }}
−
* HMDB : HMDB60399
+
{{#set: reaction associated=4-HYDROXYPHENYLPYRUVATE-DIOXYGENASE-RXN|RXN-10815}}
−
{{#set: smiles=CC(C)=CC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: pathway associated=PWY-1581|PWY-7432|TYRFUMCAT-PWY|PWY-1422|PWY-6318}}
−
{{#set: inchi key=InChIKey=ZFKZVSUJTDSJEY-SVHODSNWSA-J}}
+
−
{{#set: common name=5-methyl-3-oxo-4-hexenoyl-CoA}}
+
−
{{#set: molecular weight=887.641    }}
+
−
{{#set: consumed by=RXN-11921}}
+

Latest revision as of 19:23, 21 March 2018

Gene Tiso_gene_18977

  • right end position:
    • 2441
  • transcription direction:
    • POSITIVE
  • left end position:
    • 13
  • centisome position:
    • 0.4847129
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_18977&oldid=41265"