Difference between revisions of "L-1-GLYCEROPHOSPHORYLETHANOL-AMINE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-1-GLYCEROPHOSPHORYLETHANOL-AMINE L-1-GLYCEROPHOSPHORYLETHANOL-AMINE] == * smiles: ** C(OP([O-...") |
|||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-1-GLYCEROPHOSPHORYLETHANOL-AMINE L-1-GLYCEROPHOSPHORYLETHANOL-AMINE] == |
− | * | + | * smiles: |
− | ** [ | + | ** C(OP([O-])(OCC(CO)O)=O)C[N+] |
* common name: | * common name: | ||
− | ** | + | ** sn-glycero-3-phosphoethanolamine |
+ | * inchi key: | ||
+ | ** InChIKey=JZNWSCPGTDBMEW-RXMQYKEDSA-N | ||
+ | * molecular weight: | ||
+ | ** 215.142 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** L-1-glycerophosphorylethanolamine | ||
+ | ** 1-glycerophosphorylethanolamine | ||
− | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-14160]] | |
− | * [[RXN- | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN-15035]] | |
− | == Reaction(s) | + | == Reaction(s) of unknown directionality == |
− | * [ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: common name= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01233 C01233] |
− | {{#set: | + | * HMDB : HMDB00114 |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16929 16929] |
+ | * BIGG : g3pe | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=70678815 70678815] | ||
+ | {{#set: smiles=C(OP([O-])(OCC(CO)O)=O)C[N+]}} | ||
+ | {{#set: common name=sn-glycero-3-phosphoethanolamine}} | ||
+ | {{#set: inchi key=InChIKey=JZNWSCPGTDBMEW-RXMQYKEDSA-N}} | ||
+ | {{#set: molecular weight=215.142 }} | ||
+ | {{#set: common name=L-1-glycerophosphorylethanolamine|1-glycerophosphorylethanolamine}} | ||
+ | {{#set: consumed by=RXN-14160}} | ||
+ | {{#set: produced by=RXN-15035}} |
Latest revision as of 20:43, 21 March 2018
Contents
Metabolite L-1-GLYCEROPHOSPHORYLETHANOL-AMINE
- smiles:
- C(OP([O-])(OCC(CO)O)=O)C[N+]
- common name:
- sn-glycero-3-phosphoethanolamine
- inchi key:
- InChIKey=JZNWSCPGTDBMEW-RXMQYKEDSA-N
- molecular weight:
- 215.142
- Synonym(s):
- L-1-glycerophosphorylethanolamine
- 1-glycerophosphorylethanolamine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(OP([O-])(OCC(CO)O)=O)C[N+" cannot be used as a page name in this wiki.