Difference between revisions of "MYRICETIN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=cis-cis-D7-19-C38-2-ACPs cis-cis-D7-19-C38-2-ACPs] == * common name: ** a cis,cis-delta7,19-C38...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MYRICETIN MYRICETIN] == * smiles: ** C1(C(O)=C(O)C(O)=CC=1C2(OC3(C=C(O)C=C(O)C(C(=O)C([O-])=2)=...") |
||
(4 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MYRICETIN MYRICETIN] == |
+ | * smiles: | ||
+ | ** C1(C(O)=C(O)C(O)=CC=1C2(OC3(C=C(O)C=C(O)C(C(=O)C([O-])=2)=3))) | ||
* common name: | * common name: | ||
− | ** | + | ** myricetin |
+ | * inchi key: | ||
+ | ** InChIKey=IKMDFBPHZNJCSN-UHFFFAOYSA-M | ||
+ | * molecular weight: | ||
+ | ** 317.231 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** myricitin | ||
+ | ** cannabiscetin | ||
+ | ** myricetol | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-8450]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: common name= | + | * PUBCHEM: |
− | {{#set: produced by= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201643 25201643] |
+ | * HMDB : HMDB02755 | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58395 58395] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C10107 C10107] | ||
+ | {{#set: smiles=C1(C(O)=C(O)C(O)=CC=1C2(OC3(C=C(O)C=C(O)C(C(=O)C([O-])=2)=3)))}} | ||
+ | {{#set: common name=myricetin}} | ||
+ | {{#set: inchi key=InChIKey=IKMDFBPHZNJCSN-UHFFFAOYSA-M}} | ||
+ | {{#set: molecular weight=317.231 }} | ||
+ | {{#set: common name=myricitin|cannabiscetin|myricetol}} | ||
+ | {{#set: produced by=RXN-8450}} |
Latest revision as of 19:23, 21 March 2018
Contents
Metabolite MYRICETIN
- smiles:
- C1(C(O)=C(O)C(O)=CC=1C2(OC3(C=C(O)C=C(O)C(C(=O)C([O-])=2)=3)))
- common name:
- myricetin
- inchi key:
- InChIKey=IKMDFBPHZNJCSN-UHFFFAOYSA-M
- molecular weight:
- 317.231
- Synonym(s):
- myricitin
- cannabiscetin
- myricetol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(C(O)=C(O)C(O)=CC=1C2(OC3(C=C(O)C=C(O)C(C(=O)C([O-])=2)=3)))" cannot be used as a page name in this wiki.