Difference between revisions of "RXN0-6385"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16819 CPD-16819] == * smiles: ** CC1(C=CC(=CC=1)OS(=O)(=O)[O-]) * inchi key: ** InChIKey=WG...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-6385 RXN0-6385] == * direction: ** REVERSIBLE * common name: ** Thiosulfate/3-mercaptopyruvate...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-6385 RXN0-6385] == |
| − | * | + | * direction: |
| − | ** | + | ** REVERSIBLE |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** Thiosulfate/3-mercaptopyruvate sulfurtransferase 1, mitochondrial |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/2.8.1 EC-2.8.1] |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == Reaction(s) | + | == Reaction Formula == |
| − | == | + | * With identifiers: |
| − | == | + | ** 1 [[Red-Thioredoxin]][c] '''+''' 1 [[S2O3]][c] '''<=>''' 1 [[Ox-Thioredoxin]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[SO3]][c] '''+''' 1 [[HS]][c] |
| − | * [[ | + | * With common name(s): |
| + | ** 1 a reduced thioredoxin[c] '''+''' 1 thiosulfate[c] '''<=>''' 1 an oxidized thioredoxin[c] '''+''' 1 H+[c] '''+''' 1 sulfite[c] '''+''' 1 hydrogen sulfide[c] | ||
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[Tiso_gene_5838]] | ||
| + | ** Source: [[annotation-experimental_annotation]] | ||
| + | *** Assignment: AUTOMATED-NAME-MATCH | ||
| + | == Pathways == | ||
| + | == Reconstruction information == | ||
| + | * Category: [[annotation]] | ||
| + | ** Source: [[annotation-experimental_annotation]] | ||
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=REVERSIBLE}} | |
| − | + | {{#set: common name=Thiosulfate/3-mercaptopyruvate sulfurtransferase 1, mitochondrial}} | |
| − | + | {{#set: ec number=EC-2.8.1}} | |
| − | + | {{#set: gene associated=Tiso_gene_5838}} | |
| − | + | {{#set: in pathway=}} | |
| − | {{#set: | + | {{#set: reconstruction category=annotation}} |
| − | {{#set: | + | {{#set: reconstruction source=annotation-experimental_annotation}} |
| − | {{#set: | + | {{#set: reconstruction tool=pathwaytools}} |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 20:04, 21 March 2018
Contents
Reaction RXN0-6385
- direction:
- REVERSIBLE
- common name:
- Thiosulfate/3-mercaptopyruvate sulfurtransferase 1, mitochondrial
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 Red-Thioredoxin[c] + 1 S2O3[c] <=> 1 Ox-Thioredoxin[c] + 1 PROTON[c] + 1 SO3[c] + 1 HS[c]
- With common name(s):
- 1 a reduced thioredoxin[c] + 1 thiosulfate[c] <=> 1 an oxidized thioredoxin[c] + 1 H+[c] + 1 sulfite[c] + 1 hydrogen sulfide[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_5838
- Source: annotation-experimental_annotation
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-experimental_annotation
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-experimental_annotation
- Tool: pathwaytools
- Source: annotation-experimental_annotation
