Difference between revisions of "DIPHTHAMIDE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-482 CPD-482] == * smiles: ** C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C2)([CH](CC3)4)5)(C)))...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIPHTHAMIDE DIPHTHAMIDE] == * common name: ** a diphthamide-[translation elongation factor 2] *...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-482 CPD-482] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIPHTHAMIDE DIPHTHAMIDE] ==
* smiles:
+
** C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C2)([CH](CC3)4)5)(C)))C([O-])=O)))
+
* inchi key:
+
** InChIKey=HHDWSDSMWJQURA-GBNXXHSSSA-M
+
 
* common name:
 
* common name:
** gibberellin A51
+
** a diphthamide-[translation elongation factor 2]
* molecular weight:
+
** 331.388   
+
 
* Synonym(s):
 
* Synonym(s):
** GA51
+
** a {3-[4-(2-amino-2-carboxy-ethyl)-1H-imidazol-2-YL]-1-carbomyl-propyl}-trimethyl-ammonium
 +
** a 2-[(3R)-3-carbamoyl-3-(trimethylammonio)propyl]-L-histidyl
 +
** a 2'-[3-carboxamido-3-(trimethylammonio)propyl]-L-histidine
 +
** a peptide diphthamide
 +
** a diphthamide in eEF-2
 +
** a [translation elongation factor 2] diphthamide
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-171]]
+
* [[DIPHTINE--AMMONIA-LIGASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* LIPID_MAPS : LMPR0104170022
+
{{#set: common name=a diphthamide-[translation elongation factor 2]}}
* PUBCHEM:
+
{{#set: common name=a {3-[4-(2-amino-2-carboxy-ethyl)-1H-imidazol-2-YL]-1-carbomyl-propyl}-trimethyl-ammonium|a 2-[(3R)-3-carbamoyl-3-(trimethylammonio)propyl]-L-histidyl|a 2'-[3-carboxamido-3-(trimethylammonio)propyl]-L-histidine|a peptide diphthamide|a diphthamide in eEF-2|a [translation elongation factor 2] diphthamide}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245666 25245666]
+
{{#set: produced by=DIPHTINE--AMMONIA-LIGASE-RXN}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=29599 29599]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C11865 C11865]
+
* HMDB : HMDB35041
+
{{#set: smiles=C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C2)([CH](CC3)4)5)(C)))C([O-])=O)))}}
+
{{#set: inchi key=InChIKey=HHDWSDSMWJQURA-GBNXXHSSSA-M}}
+
{{#set: common name=gibberellin A51}}
+
{{#set: molecular weight=331.388    }}
+
{{#set: common name=GA51}}
+
{{#set: produced by=RXN-171}}
+

Latest revision as of 20:04, 21 March 2018

Metabolite DIPHTHAMIDE

  • common name:
    • a diphthamide-[translation elongation factor 2]
  • Synonym(s):
    • a {3-[4-(2-amino-2-carboxy-ethyl)-1H-imidazol-2-YL]-1-carbomyl-propyl}-trimethyl-ammonium
    • a 2-[(3R)-3-carbamoyl-3-(trimethylammonio)propyl]-L-histidyl
    • a 2'-[3-carboxamido-3-(trimethylammonio)propyl]-L-histidine
    • a peptide diphthamide
    • a diphthamide in eEF-2
    • a [translation elongation factor 2] diphthamide

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a diphthamide-[translation elongation factor 2" cannot be used as a page name in this wiki.
  • "a {3-[4-(2-amino-2-carboxy-ethyl)-1H-imidazol-2-YL]-1-carbomyl-propyl}-trimethyl-ammonium" cannot be used as a page name in this wiki.
  • "a 2-[(3R)-3-carbamoyl-3-(trimethylammonio)propyl]-L-histidyl" cannot be used as a page name in this wiki.
  • "a 2'-[3-carboxamido-3-(trimethylammonio)propyl]-L-histidine" cannot be used as a page name in this wiki.
  • "a [translation elongation factor 2] diphthamide" cannot be used as a page name in this wiki.