Difference between revisions of "3.4.23.1-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PANTETHEINE-P PANTETHEINE-P] == * smiles: ** CC(C(O)C(=O)NCCC(NCCS)=O)(C)COP([O-])(=O)[O-] * in...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.4.23.1-RXN 3.4.23.1-RXN] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.o...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.4.23.1-RXN 3.4.23.1-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/3.4.23.1 EC-3.4.23.1] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | = | + | ** 1 [[WATER]][c] '''+''' 1 [[General-Protein-Substrates]][c] '''=>''' 1 [[Peptides-holder]][c] |
− | * [[ | + | * With common name(s): |
− | == | + | ** 1 H2O[c] '''+''' 1 a protein[c] '''=>''' 1 a peptide[c] |
− | * [[ | + | |
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_12450]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_1894]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | * | + | * UNIPROT: |
− | * | + | ** [http://www.uniprot.org/uniprot/Q7M319 Q7M319] |
− | ** [http:// | + | ** [http://www.uniprot.org/uniprot/P04073 P04073] |
− | * | + | ** [http://www.uniprot.org/uniprot/P13636 P13636] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q7LZP4 Q7LZP4] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/Q7LZF2 Q7LZF2] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q28158 Q28158] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/Q28157 Q28157] |
− | * | + | ** [http://www.uniprot.org/uniprot/P00792 P00792] |
− | + | ** [http://www.uniprot.org/uniprot/Q9PRG9 Q9PRG9] | |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P00790 P00790] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P03954 P03954] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P11489 P11489] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P00791 P00791] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P27678 P27678] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P27677 P27677] |
− | {{#set: | + | {{#set: direction=LEFT-TO-RIGHT}} |
+ | {{#set: ec number=EC-3.4.23.1}} | ||
+ | {{#set: gene associated=Tiso_gene_12450|Tiso_gene_1894}} | ||
+ | {{#set: in pathway=}} | ||
+ | {{#set: reconstruction category=orthology}} | ||
+ | {{#set: reconstruction source=orthology-esiliculosus}} | ||
+ | {{#set: reconstruction tool=pantograph}} |
Latest revision as of 19:04, 21 March 2018
Contents
Reaction 3.4.23.1-RXN
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 WATER[c] + 1 General-Protein-Substrates[c] => 1 Peptides-holder[c]
- With common name(s):
- 1 H2O[c] + 1 a protein[c] => 1 a peptide[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_12450
- Source: orthology-esiliculosus
- Gene: Tiso_gene_1894
- Source: orthology-esiliculosus
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus
External links
- UNIPROT: