Difference between revisions of "RXN-14950"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PROTOPORPHYRIN_IX PROTOPORPHYRIN_IX] == * smiles: ** C=CC1(C(C)=C2(C=C5(C(C)=C(CCC([O-])=O)C(C=...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14950 RXN-14950] == * direction: ** LEFT-TO-RIGHT * common name: ** lipoyl_synthase_mitochondri...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PROTOPORPHYRIN_IX PROTOPORPHYRIN_IX] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14950 RXN-14950] ==
−
* smiles:
+
* direction:
−
** C=CC1(C(C)=C2(C=C5(C(C)=C(CCC([O-])=O)C(C=C4(C(CCC([O-])=O)=C(C)C(=CC3(C(C=C)=C(C)C(=CC=1N2)N=3))N4))=N5)))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=KSFOVUSSGSKXFI-UJJXFSCMSA-L
+
 
* common name:
 
* common name:
−
** protoporphyrin IX
+
** lipoyl_synthase_mitochondrial
−
* molecular weight:
+
** lipoyl_mitochondrial
−
** 560.651   
+
* ec number:
 +
** [http://enzyme.expasy.org/EC/2.8.1.8 EC-2.8.1.8]
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN1F-20]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 2 [[Sulfurated-Sulfur-Acceptors]][c] '''+''' 1 [[Octanoylated-Gcv-H]][c] '''+''' 2 [[Reduced-2Fe-2S-Ferredoxins]][c] '''+''' 2 [[S-ADENOSYLMETHIONINE]][c] '''=>''' 2 [[Oxidized-2Fe-2S-Ferredoxins]][c] '''+''' 2 [[Unsulfurated-Sulfur-Acceptors]][c] '''+''' 1 [[PROTEIN-LIPOYLLYSINE]][c] '''+''' 2 [[MET]][c] '''+''' 2 [[CH33ADO]][c]
−
* [[PROTOPORGENOXI-RXN]]
+
* With common name(s):
−
* [[PPPGO]]
+
** 2 a sulfurated [sulfur carrier][c] '''+''' 1 a [glycine-cleavage complex H protein] N6-octanoyl-L-lysine[c] '''+''' 2 a reduced [2Fe-2S] ferredoxin[c] '''+''' 2 S-adenosyl-L-methionine[c] '''=>''' 2 an oxidized [2Fe-2S] ferredoxin[c] '''+''' 2 an unsulfurated [sulfur carrier][c] '''+''' 1 a [glycine-cleavage complex H protein] N6-lipoyl-L-lysine[c] '''+''' 2 L-methionine[c] '''+''' 2 5'-deoxyadenosine[c]
−
== Reaction(s) of unknown directionality ==
+
 
−
* [[PROTOHEMEFERROCHELAT-RXN]]
+
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_437]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_8049]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-7382]], lipoate biosynthesis and incorporation (yeast): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7382 PWY-7382]
 +
** '''4''' reactions found over '''7''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* CAS : 553-12-8
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* PUBCHEM:
+
{{#set: common name=lipoyl_synthase_mitochondrial}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=3794562 3794562]
+
{{#set: common name=lipoyl_mitochondrial}}
−
* HMDB : HMDB00241
+
{{#set: ec number=EC-2.8.1.8}}
−
* LIGAND-CPD:
+
{{#set: gene associated=Tiso_gene_437|Tiso_gene_8049}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C02191 C02191]
+
{{#set: in pathway=PWY-7382}}
−
* CHEMSPIDER:
+
{{#set: reconstruction category=annotation}}
−
** [http://www.chemspider.com/Chemical-Structure.20171337.html 20171337]
+
{{#set: reconstruction source=annotation-in-silico_annotation}}
−
* CHEBI:
+
{{#set: reconstruction tool=pathwaytools}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57306 57306]
+
−
* BIGG : ppp9
+
−
{{#set: smiles=C=CC1(C(C)=C2(C=C5(C(C)=C(CCC([O-])=O)C(C=C4(C(CCC([O-])=O)=C(C)C(=CC3(C(C=C)=C(C)C(=CC=1N2)N=3))N4))=N5)))}}
+
−
{{#set: inchi key=InChIKey=KSFOVUSSGSKXFI-UJJXFSCMSA-L}}
+
−
{{#set: common name=protoporphyrin IX}}
+
−
{{#set: molecular weight=560.651    }}
+
−
{{#set: consumed by=RXN1F-20}}
+
−
{{#set: produced by=PROTOPORGENOXI-RXN|PPPGO}}
+
−
{{#set: reversible reaction associated=PROTOHEMEFERROCHELAT-RXN}}
+

Latest revision as of 19:05, 21 March 2018

Reaction RXN-14950

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • lipoyl_synthase_mitochondrial
    • lipoyl_mitochondrial
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7382, lipoate biosynthesis and incorporation (yeast): PWY-7382
    • 4 reactions found over 7 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-14950&oldid=39355"