|
|
| (One intermediate revision by the same user not shown) |
| Line 1: |
Line 1: |
| − | [[Category:Pathway]] | + | [[Category:Metabolite]] |
| − | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7210 PWY-7210] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-MERCAPTO-PYRUVATE 3-MERCAPTO-PYRUVATE] == |
| − | * taxonomic range: | + | * smiles: |
| − | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751] | + | ** C(C(C(=O)[O-])=O)S |
| − | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-33208]
| + | |
| − | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1239 TAX-1239]
| + | |
| − | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-201174 TAX-201174]
| + | |
| | * common name: | | * common name: |
| − | ** pyrimidine deoxyribonucleotides biosynthesis from CTP | + | ** 3-mercaptopyruvate |
| | + | * inchi key: |
| | + | ** InChIKey=OJOLFAIGOXZBCI-UHFFFAOYSA-M |
| | + | * molecular weight: |
| | + | ** 119.115 |
| | * Synonym(s): | | * Synonym(s): |
| | + | ** mercaptopyruvate |
| | + | ** 3-mercaptopyruvic acid |
| | + | ** β-thiopyruvate |
| | + | ** β-mercaptopyruvate |
| | | | |
| − | == Reaction(s) found == | + | == Reaction(s) known to consume the compound == |
| − | '''8''' reactions found over '''8''' reactions in the full pathway
| + | * [[MERCAPYSTRANS-RXN]] |
| − | * [[CDPREDUCT-RXN]] | + | == Reaction(s) known to produce the compound == |
| − | ** 4 associated gene(s):
| + | == Reaction(s) of unknown directionality == |
| − | *** [[Tiso_gene_10617]]
| + | * [[CYSTEINE-AMINOTRANSFERASE-RXN]] |
| − | *** [[Tiso_gene_9916]]
| + | |
| − | *** [[Tiso_gene_9915]]
| + | |
| − | *** [[Tiso_gene_10138]]
| + | |
| − | ** 6 reconstruction source(s) associated:
| + | |
| − | *** [[annotation-experimental_annotation]]
| + | |
| − | *** [[orthology-esiliculosus]]
| + | |
| − | *** [[annotation-in-silico_annotation]]
| + | |
| − | *** [[orthology-athaliana]]
| + | |
| − | *** [[orthology-synechocystis]]
| + | |
| − | *** [[manual-primary_network]]
| + | |
| − | * [[DCDPKIN-RXN]]
| + | |
| − | ** 6 associated gene(s):
| + | |
| − | *** [[Tiso_gene_9290]]
| + | |
| − | *** [[Tiso_gene_18224]]
| + | |
| − | *** [[Tiso_gene_17272]]
| + | |
| − | *** [[Tiso_gene_16529]]
| + | |
| − | *** [[Tiso_gene_17271]]
| + | |
| − | *** [[Tiso_gene_195]]
| + | |
| − | ** 6 reconstruction source(s) associated:
| + | |
| − | *** [[annotation-experimental_annotation]]
| + | |
| − | *** [[orthology-esiliculosus]]
| + | |
| − | *** [[annotation-in-silico_annotation]]
| + | |
| − | *** [[orthology-athaliana]]
| + | |
| − | *** [[orthology-synechocystis]]
| + | |
| − | *** [[manual-primary_network]]
| + | |
| − | * [[DCMP-DEAMINASE-RXN]]
| + | |
| − | ** 1 associated gene(s):
| + | |
| − | *** [[Tiso_gene_2978]]
| + | |
| − | ** 2 reconstruction source(s) associated:
| + | |
| − | *** [[orthology-athaliana]]
| + | |
| − | *** [[orthology-esiliculosus]]
| + | |
| − | * [[DTDPKIN-RXN]]
| + | |
| − | ** 6 associated gene(s):
| + | |
| − | *** [[Tiso_gene_18224]]
| + | |
| − | *** [[Tiso_gene_16529]]
| + | |
| − | *** [[Tiso_gene_195]]
| + | |
| − | *** [[Tiso_gene_17271]]
| + | |
| − | *** [[Tiso_gene_17272]]
| + | |
| − | *** [[Tiso_gene_9290]]
| + | |
| − | ** 6 reconstruction source(s) associated:
| + | |
| − | *** [[annotation-experimental_annotation]]
| + | |
| − | *** [[orthology-esiliculosus]]
| + | |
| − | *** [[annotation-in-silico_annotation]]
| + | |
| − | *** [[orthology-athaliana]]
| + | |
| − | *** [[orthology-synechocystis]]
| + | |
| − | *** [[manual-primary_network]]
| + | |
| − | * [[DTMPKI-RXN]]
| + | |
| − | ** 1 associated gene(s):
| + | |
| − | *** [[Tiso_gene_3755]]
| + | |
| − | ** 3 reconstruction source(s) associated:
| + | |
| − | *** [[annotation-in-silico_annotation]]
| + | |
| − | *** [[manual-primary_network]]
| + | |
| − | *** [[annotation-experimental_annotation]]
| + | |
| − | * [[RXN-12195]]
| + | |
| − | ** 101 associated gene(s):
| + | |
| − | *** [[Tiso_gene_8860]]
| + | |
| − | *** [[Tiso_gene_11098]]
| + | |
| − | *** [[Tiso_gene_1960]]
| + | |
| − | *** [[Tiso_gene_1611]]
| + | |
| − | *** [[Tiso_gene_3653]]
| + | |
| − | *** [[Tiso_gene_12899]]
| + | |
| − | *** [[Tiso_gene_1444]]
| + | |
| − | *** [[Tiso_gene_2924]]
| + | |
| − | *** [[Tiso_gene_8949]]
| + | |
| − | *** [[Tiso_gene_17616]]
| + | |
| − | *** [[Tiso_gene_546]]
| + | |
| − | *** [[Tiso_gene_14226]]
| + | |
| − | *** [[Tiso_gene_4026]]
| + | |
| − | *** [[Tiso_gene_14646]]
| + | |
| − | *** [[Tiso_gene_2447]]
| + | |
| − | *** [[Tiso_gene_674]]
| + | |
| − | *** [[Tiso_gene_5166]]
| + | |
| − | *** [[Tiso_gene_195]]
| + | |
| − | *** [[Tiso_gene_8601]]
| + | |
| − | *** [[Tiso_gene_4596]]
| + | |
| − | *** [[Tiso_gene_13738]]
| + | |
| − | *** [[Tiso_gene_5525]]
| + | |
| − | *** [[Tiso_gene_538]]
| + | |
| − | *** [[Tiso_gene_2449]]
| + | |
| − | *** [[Tiso_gene_19098]]
| + | |
| − | *** [[Tiso_gene_12148]]
| + | |
| − | *** [[Tiso_gene_1291]]
| + | |
| − | *** [[Tiso_gene_20327]]
| + | |
| − | *** [[Tiso_gene_4436]]
| + | |
| − | *** [[Tiso_gene_7387]]
| + | |
| − | *** [[Tiso_gene_12149]]
| + | |
| − | *** [[Tiso_gene_2451]]
| + | |
| − | *** [[Tiso_gene_6614]]
| + | |
| − | *** [[Tiso_gene_199]]
| + | |
| − | *** [[Tiso_gene_9114]]
| + | |
| − | *** [[Tiso_gene_2450]]
| + | |
| − | *** [[Tiso_gene_14474]]
| + | |
| − | *** [[Tiso_gene_8461]]
| + | |
| − | *** [[Tiso_gene_4437]]
| + | |
| − | *** [[Tiso_gene_8584]]
| + | |
| − | *** [[Tiso_gene_4155]]
| + | |
| − | *** [[Tiso_gene_8164]]
| + | |
| − | *** [[Tiso_gene_572]]
| + | |
| − | *** [[Tiso_gene_9243]]
| + | |
| − | *** [[Tiso_gene_4330]]
| + | |
| − | *** [[Tiso_gene_9959]]
| + | |
| − | *** [[Tiso_gene_2897]]
| + | |
| − | *** [[Tiso_gene_623]]
| + | |
| − | *** [[Tiso_gene_9926]]
| + | |
| − | *** [[Tiso_gene_19350]]
| + | |
| − | *** [[Tiso_gene_6181]]
| + | |
| − | *** [[Tiso_gene_2631]]
| + | |
| − | *** [[Tiso_gene_2929]]
| + | |
| − | *** [[Tiso_gene_9423]]
| + | |
| − | *** [[Tiso_gene_16478]]
| + | |
| − | *** [[Tiso_gene_6180]]
| + | |
| − | *** [[Tiso_gene_1984]]
| + | |
| − | *** [[Tiso_gene_873]]
| + | |
| − | *** [[Tiso_gene_2452]]
| + | |
| − | *** [[Tiso_gene_15465]]
| + | |
| − | *** [[Tiso_gene_3287]]
| + | |
| − | *** [[Tiso_gene_4092]]
| + | |
| − | *** [[Tiso_gene_8763]]
| + | |
| − | *** [[Tiso_gene_9004]]
| + | |
| − | *** [[Tiso_gene_14816]]
| + | |
| − | *** [[Tiso_gene_5529]]
| + | |
| − | *** [[Tiso_gene_4192]]
| + | |
| − | *** [[Tiso_gene_7745]]
| + | |
| − | *** [[Tiso_gene_8859]]
| + | |
| − | *** [[Tiso_gene_829]]
| + | |
| − | *** [[Tiso_gene_4194]]
| + | |
| − | *** [[Tiso_gene_15043]]
| + | |
| − | *** [[Tiso_gene_14227]]
| + | |
| − | *** [[Tiso_gene_250]]
| + | |
| − | *** [[Tiso_gene_1541]]
| + | |
| − | *** [[Tiso_gene_537]]
| + | |
| − | *** [[Tiso_gene_9234]]
| + | |
| − | *** [[Tiso_gene_7123]]
| + | |
| − | *** [[Tiso_gene_10282]]
| + | |
| − | *** [[Tiso_gene_4726]]
| + | |
| − | *** [[Tiso_gene_20353]]
| + | |
| − | *** [[Tiso_gene_2448]]
| + | |
| − | *** [[Tiso_gene_38]]
| + | |
| − | *** [[Tiso_gene_11012]]
| + | |
| − | *** [[Tiso_gene_2176]]
| + | |
| − | *** [[Tiso_gene_17751]]
| + | |
| − | *** [[Tiso_gene_13325]]
| + | |
| − | *** [[Tiso_gene_7734]]
| + | |
| − | *** [[Tiso_gene_1959]]
| + | |
| − | *** [[Tiso_gene_13268]]
| + | |
| − | *** [[Tiso_gene_9659]]
| + | |
| − | *** [[Tiso_gene_8950]]
| + | |
| − | *** [[Tiso_gene_2068]]
| + | |
| − | *** [[Tiso_gene_14239]]
| + | |
| − | *** [[Tiso_gene_13264]]
| + | |
| − | *** [[Tiso_gene_2889]]
| + | |
| − | *** [[Tiso_gene_13681]]
| + | |
| − | *** [[Tiso_gene_1610]]
| + | |
| − | *** [[Tiso_gene_13653]]
| + | |
| − | *** [[Tiso_gene_17449]]
| + | |
| − | *** [[Tiso_gene_10221]]
| + | |
| − | ** 3 reconstruction source(s) associated:
| + | |
| − | *** [[annotation-experimental_annotation]]
| + | |
| − | *** [[annotation-in-silico_annotation]]
| + | |
| − | *** [[orthology-esiliculosus]]
| + | |
| − | * [[RXN-14187]]
| + | |
| − | ** 2 associated gene(s):
| + | |
| − | *** [[Tiso_gene_20236]]
| + | |
| − | *** [[Tiso_gene_12899]]
| + | |
| − | ** 3 reconstruction source(s) associated:
| + | |
| − | *** [[annotation-experimental_annotation]]
| + | |
| − | *** [[annotation-in-silico_annotation]]
| + | |
| − | *** [[orthology-esiliculosus]]
| + | |
| − | * [[THYMIDYLATESYN-RXN]]
| + | |
| − | ** 2 associated gene(s):
| + | |
| − | *** [[Tiso_gene_18478]]
| + | |
| − | *** [[Tiso_gene_7708]]
| + | |
| − | ** 2 reconstruction source(s) associated:
| + | |
| − | *** [[manual-primary_network]]
| + | |
| − | *** [[annotation-in-silico_annotation]]
| + | |
| − | == Reaction(s) not found ==
| + | |
| | == External links == | | == External links == |
| − | {{#set: taxonomic range=TAX-4751}}
| + | * CAS : 2464-23-5 |
| − | {{#set: taxonomic range=TAX-33208}} | + | * BIGG : mercppyr |
| − | {{#set: taxonomic range=TAX-1239}} | + | * PUBCHEM: |
| − | {{#set: taxonomic range=TAX-201174}} | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=4182595 4182595] |
| − | {{#set: common name=pyrimidine deoxyribonucleotides biosynthesis from CTP}} | + | * HMDB : HMDB01368 |
| − | {{#set: reaction found=8}} | + | * LIGAND-CPD: |
| − | {{#set: total reaction=8}} | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00957 C00957] |
| − | {{#set: completion rate=100.0}} | + | * CHEMSPIDER: |
| | + | ** [http://www.chemspider.com/Chemical-Structure.3393581.html 3393581] |
| | + | * CHEBI: |
| | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57678 57678] |
| | + | * METABOLIGHTS : MTBLC57678 |
| | + | {{#set: smiles=C(C(C(=O)[O-])=O)S}} |
| | + | {{#set: common name=3-mercaptopyruvate}} |
| | + | {{#set: inchi key=InChIKey=OJOLFAIGOXZBCI-UHFFFAOYSA-M}} |
| | + | {{#set: molecular weight=119.115 }} |
| | + | {{#set: common name=mercaptopyruvate|3-mercaptopyruvic acid|β-thiopyruvate|β-mercaptopyruvate}} |
| | + | {{#set: consumed by=MERCAPYSTRANS-RXN}} |
| | + | {{#set: reversible reaction associated=CYSTEINE-AMINOTRANSFERASE-RXN}} |
