Difference between revisions of "CPD-723"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11680 RXN-11680] == * direction: ** LEFT-TO-RIGHT * common name: ** Delta-6 fatty acid desatura...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-723 CPD-723] == * smiles: ** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)C(O)CC(C...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11680 RXN-11680] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-723 CPD-723] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)C(O)CC(C)1[CH]2CCC(C)34))))
 
* common name:
 
* common name:
−
** Delta-6 fatty acid desaturase
+
** 6-deoxocastasterone
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/1.14.19.47 EC-1.14.19.47]
+
** InChIKey=VXBLCLVRWCLEOX-BFYSZXNBSA-N
 +
* molecular weight:
 +
** 450.701   
 
* Synonym(s):
 
* Synonym(s):
 +
** deoxocastasterone
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-778]]
−
** 1 [[Linoleoyl-groups]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 2 [[PROTON]][c] '''+''' 2 [[FERROCYTOCHROME-B5]][c] '''=>''' 2 [[WATER]][c] '''+''' 2 [[FERRICYTOCHROME-B5]][c] '''+''' 1 [[Gamma-linolenoyl-groups]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 a [glycerolipid]-linoleate[c] '''+''' 1 oxygen[c] '''+''' 2 H+[c] '''+''' 2 a ferrocytochrome b5[c] '''=>''' 2 H2O[c] '''+''' 2 a ferricytochrome b5[c] '''+''' 1 a [glycerolipid]-γ-linolenate[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_18205]]
+
−
** IN-SILICO_ANNOTATION
+
−
***AUTOMATED-NAME-MATCH
+
−
* [[Tiso_gene_18056]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
* [[Tiso_gene_9580]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
* [[Tiso_gene_7427]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
* [[Tiso_gene_8027]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways  ==
+
−
* [[PWY-5353]], arachidonate biosynthesis I (6-desaturase, lower eukaryotes): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5353 PWY-5353]
+
−
** '''3''' reactions found over '''8''' reactions in the full pathway
+
−
* [[PWY-6603]], dicranin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6603 PWY-6603]
+
−
** '''1''' reactions found over '''4''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
*** Tool: [[pantograph]]
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
* LIGAND-RXN:
+
* LIPID_MAPS : LMST01030127
−
** [http://www.genome.jp/dbget-bin/www_bget?R07063 R07063]
+
* PUBCHEM:
−
{{#set: direction=LEFT-TO-RIGHT}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=13870433 13870433]
−
{{#set: common name=Delta-6 fatty acid desaturase}}
+
* HMDB : HMDB33984
−
{{#set: ec number=EC-1.14.19.47}}
+
* CHEBI:
−
{{#set: gene associated=Tiso_gene_18205|Tiso_gene_18056|Tiso_gene_9580|Tiso_gene_7427|Tiso_gene_8027}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=20712 20712]
−
{{#set: in pathway=PWY-5353|PWY-6603}}
+
* LIGAND-CPD:
−
{{#set: reconstruction category=orthology|annotation}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C15802 C15802]
−
{{#set: reconstruction source=annotation-in-silico_annotation|orthology-esiliculosus}}
+
{{#set: smiles=CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)C(O)CC(C)1[CH]2CCC(C)34))))}}
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
+
{{#set: common name=6-deoxocastasterone}}
 +
{{#set: inchi key=InChIKey=VXBLCLVRWCLEOX-BFYSZXNBSA-N}}
 +
{{#set: molecular weight=450.701    }}
 +
{{#set: common name=deoxocastasterone}}
 +
{{#set: consumed by=RXN-778}}

Latest revision as of 19:05, 21 March 2018

Metabolite CPD-723

  • smiles:
    • CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)C(O)CC(C)1[CH]2CCC(C)34))))
  • common name:
    • 6-deoxocastasterone
  • inchi key:
    • InChIKey=VXBLCLVRWCLEOX-BFYSZXNBSA-N
  • molecular weight:
    • 450.701
  • Synonym(s):
    • deoxocastasterone

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

  • LIPID_MAPS : LMST01030127
  • PUBCHEM:
  • HMDB : HMDB33984
  • CHEBI:
  • LIGAND-CPD:
"CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)C(O)CC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-723&oldid=39370"