Difference between revisions of "CPD-10330"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_5023 == * left end position: ** 718 * transcription direction: ** POSITIVE * right end position: ** 4811 * centisome position: ** 3.7029397...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10330 CPD-10330] == * smiles: ** C(C1(C(C(C(O1)O)O)O))O * common name: ** α-D-ribofur...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_5023 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10330 CPD-10330] ==
* left end position:
+
* smiles:
** 718
+
** C(C1(C(C(C(O1)O)O)O))O
* transcription direction:
+
* common name:
** POSITIVE
+
** α-D-ribofuranose
* right end position:
+
* inchi key:
** 4811
+
** InChIKey=HMFHBZSHGGEWLO-AIHAYLRMSA-N
* centisome position:
+
* molecular weight:
** 3.7029397    
+
** 150.131    
 
* Synonym(s):
 
* Synonym(s):
 +
** α D-ribose
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[PEPTIDYLPROLYL-ISOMERASE-RXN]]
+
* [[RIBOKIN-RXN]]
** in-silico_annotation
+
== Reaction(s) known to produce the compound ==
***ec-number
+
== Reaction(s) of unknown directionality ==
== Pathways associated ==
+
* [[RXN-14904]]
 
== External links  ==
 
== External links  ==
{{#set: left end position=718}}
+
* PUBCHEM:
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=445894 445894]
{{#set: right end position=4811}}
+
* CHEMSPIDER:
{{#set: centisome position=3.7029397   }}
+
** [http://www.chemspider.com/Chemical-Structure.5575.html 5575]
{{#set: reaction associated=PEPTIDYLPROLYL-ISOMERASE-RXN}}
+
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=45506 45506]
 +
* HMDB : HMDB00283
 +
{{#set: smiles=C(C1(C(C(C(O1)O)O)O))O}}
 +
{{#set: common name=α-D-ribofuranose}}
 +
{{#set: inchi key=InChIKey=HMFHBZSHGGEWLO-AIHAYLRMSA-N}}
 +
{{#set: molecular weight=150.131   }}
 +
{{#set: common name=α D-ribose}}
 +
{{#set: consumed by=RIBOKIN-RXN}}
 +
{{#set: reversible reaction associated=RXN-14904}}

Latest revision as of 20:05, 21 March 2018

Metabolite CPD-10330

  • smiles:
    • C(C1(C(C(C(O1)O)O)O))O
  • common name:
    • α-D-ribofuranose
  • inchi key:
    • InChIKey=HMFHBZSHGGEWLO-AIHAYLRMSA-N
  • molecular weight:
    • 150.131
  • Synonym(s):
    • α D-ribose

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links