Difference between revisions of "CPD-12016"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=THIAMIN-PYROPHOSPHOKINASE-RXN THIAMIN-PYROPHOSPHOKINASE-RXN] == * direction: ** LEFT-TO-RIGHT * com...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12016 CPD-12016] == * smiles: ** CC(=O)NCCC2(=CNC3(=CC=C(OC1(OC(C([O-])=O)C(O)C(O)C(O)1))C=...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=THIAMIN-PYROPHOSPHOKINASE-RXN THIAMIN-PYROPHOSPHOKINASE-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12016 CPD-12016] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(=O)NCCC2(=CNC3(=CC=C(OC1(OC(C([O-])=O)C(O)C(O)C(O)1))C=C23))
 
* common name:
 
* common name:
−
** thiamine_pyrophosphokinase
+
** N-acetyl-serotonin glucuronide
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/2.7.6.2 EC-2.7.6.2]
+
** InChIKey=DRKQFNYKSNWOTC-RNGZQALNSA-M
 +
* molecular weight:
 +
** 393.372   
 
* Synonym(s):
 
* Synonym(s):
 +
** N-acetyl-5-hydroxytryptamine glucuronide
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[THIAMINE]][c] '''+''' 1 [[ATP]][c] '''=>''' 1 [[THIAMINE-PYROPHOSPHATE]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[AMP]][c]
+
* [[RXN-11060]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 thiamine[c] '''+''' 1 ATP[c] '''=>''' 1 thiamine diphosphate[c] '''+''' 1 H+[c] '''+''' 1 AMP[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_16512]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways  ==
+
−
* [[PWY-6907]], thiamine diphosphate biosynthesis III (Staphylococcus): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6907 PWY-6907]
+
−
** '''3''' reactions found over '''3''' reactions in the full pathway
+
−
* [[PWY-6898]], thiamine salvage III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6898 PWY-6898]
+
−
** '''1''' reactions found over '''1''' reactions in the full pathway
+
−
* [[PWY-7356]], thiamine salvage IV (yeast): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7356 PWY-7356]
+
−
** '''5''' reactions found over '''7''' reactions in the full pathway
+
−
* [[PWY-6908]], thiamine diphosphate biosynthesis IV (eukaryotes): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6908 PWY-6908]
+
−
** '''3''' reactions found over '''3''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
*** Tool: [[pantograph]]
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=11576 11576]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=29971053 29971053]
−
* LIGAND-RXN:
+
{{#set: smiles=CC(=O)NCCC2(=CNC3(=CC=C(OC1(OC(C([O-])=O)C(O)C(O)C(O)1))C=C23))}}
−
** [http://www.genome.jp/dbget-bin/www_bget?R00619 R00619]
+
{{#set: common name=N-acetyl-serotonin glucuronide}}
−
* UNIPROT:
+
{{#set: inchi key=InChIKey=DRKQFNYKSNWOTC-RNGZQALNSA-M}}
−
** [http://www.uniprot.org/uniprot/P35202 P35202]
+
{{#set: molecular weight=393.372    }}
−
** [http://www.uniprot.org/uniprot/P41888 P41888]
+
{{#set: common name=N-acetyl-5-hydroxytryptamine glucuronide}}
−
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: produced by=RXN-11060}}
−
{{#set: common name=thiamine_pyrophosphokinase}}
+
−
{{#set: ec number=EC-2.7.6.2}}
+
−
{{#set: gene associated=Tiso_gene_16512}}
+
−
{{#set: in pathway=PWY-6907|PWY-6898|PWY-7356|PWY-6908}}
+
−
{{#set: reconstruction category=orthology|annotation}}
+
−
{{#set: reconstruction source=annotation-in-silico_annotation|orthology-esiliculosus}}
+
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
+

Latest revision as of 19:06, 21 March 2018

Metabolite CPD-12016

  • smiles:
    • CC(=O)NCCC2(=CNC3(=CC=C(OC1(OC(C([O-])=O)C(O)C(O)C(O)1))C=C23))
  • common name:
    • N-acetyl-serotonin glucuronide
  • inchi key:
    • InChIKey=DRKQFNYKSNWOTC-RNGZQALNSA-M
  • molecular weight:
    • 393.372
  • Synonym(s):
    • N-acetyl-5-hydroxytryptamine glucuronide

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(=O)NCCC2(=CNC3(=CC=C(OC1(OC(C([O-])=O)C(O)C(O)C(O)1))C=C23))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-12016&oldid=39461"