Difference between revisions of "CPD-7031"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-HYDROXYISOURATE 5-HYDROXYISOURATE] == * smiles: ** C2(C1(O)(NC(=O)NC1=NC(=O)N2))(=O) * inchi...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7031 CPD-7031] == * smiles: ** CC(C)C[CH]=O * common name: ** 3-methylbutanal * inchi key:...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7031 CPD-7031] == |
* smiles: | * smiles: | ||
| − | ** | + | ** CC(C)C[CH]=O |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** 3-methylbutanal |
| + | * inchi key: | ||
| + | ** InChIKey=YGHRJJRRZDOVPD-UHFFFAOYSA-N | ||
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 86.133 |
* Synonym(s): | * Synonym(s): | ||
| + | ** isovaleraldehyde | ||
| + | ** isoamylaldehyde | ||
| + | ** isopentaldehyde | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[RXN-7693]] | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=11552 11552] |
| − | + | ||
| − | + | ||
| − | + | ||
* CHEMSPIDER: | * CHEMSPIDER: | ||
| − | ** [http://www.chemspider.com/Chemical-Structure. | + | ** [http://www.chemspider.com/Chemical-Structure.11065.html 11065] |
| + | * HMDB : HMDB06478 | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16638 16638] |
| − | * | + | * LIGAND-CPD: |
| − | {{#set: smiles= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C07329 C07329] |
| − | {{#set: inchi key=InChIKey= | + | {{#set: smiles=CC(C)C[CH]=O}} |
| − | {{#set: | + | {{#set: common name=3-methylbutanal}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=YGHRJJRRZDOVPD-UHFFFAOYSA-N}} |
| − | {{#set: | + | {{#set: molecular weight=86.133 }} |
| + | {{#set: common name=isovaleraldehyde|isoamylaldehyde|isopentaldehyde}} | ||
| + | {{#set: reversible reaction associated=RXN-7693}} | ||
Latest revision as of 19:06, 21 March 2018
Contents
Metabolite CPD-7031
- smiles:
- CC(C)C[CH]=O
- common name:
- 3-methylbutanal
- inchi key:
- InChIKey=YGHRJJRRZDOVPD-UHFFFAOYSA-N
- molecular weight:
- 86.133
- Synonym(s):
- isovaleraldehyde
- isoamylaldehyde
- isopentaldehyde
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)C[CH]=O" cannot be used as a page name in this wiki.
