Difference between revisions of "7-METHYLXANTHINE"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_5241 == * left end position: ** 8515 * transcription direction: ** POSITIVE * right end position: ** 11142 * centisome position: ** 62.0129...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=7-METHYLXANTHINE 7-METHYLXANTHINE] == * smiles: ** CN1(C=NC2(NC(=O)NC(=O)C1=2)) * common name:...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=7-METHYLXANTHINE 7-METHYLXANTHINE] == |
| − | * | + | * smiles: |
| − | ** | + | ** CN1(C=NC2(NC(=O)NC(=O)C1=2)) |
| − | * | + | * common name: |
| − | ** | + | ** 7-methylxanthine |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=PFWLFWPASULGAN-UHFFFAOYSA-N |
| − | * | + | * molecular weight: |
| − | ** | + | ** 166.139 |
* Synonym(s): | * Synonym(s): | ||
| + | ** heteroxanthine | ||
| + | ** 3,7-dihydro-7-methyl-1H-purine-2,6-dione | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-11521]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == | + | |
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=68374 68374] |
| − | {{#set: | + | * CHEMSPIDER: |
| − | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.61660.html 61660] |
| − | {{#set: | + | * HMDB : HMDB01991 |
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=48991 48991] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C16353 C16353] | ||
| + | {{#set: smiles=CN1(C=NC2(NC(=O)NC(=O)C1=2))}} | ||
| + | {{#set: common name=7-methylxanthine}} | ||
| + | {{#set: inchi key=InChIKey=PFWLFWPASULGAN-UHFFFAOYSA-N}} | ||
| + | {{#set: molecular weight=166.139 }} | ||
| + | {{#set: common name=heteroxanthine|3,7-dihydro-7-methyl-1H-purine-2,6-dione}} | ||
| + | {{#set: consumed by=RXN-11521}} | ||
Latest revision as of 19:06, 21 March 2018
Contents
Metabolite 7-METHYLXANTHINE
- smiles:
- CN1(C=NC2(NC(=O)NC(=O)C1=2))
- common name:
- 7-methylxanthine
- inchi key:
- InChIKey=PFWLFWPASULGAN-UHFFFAOYSA-N
- molecular weight:
- 166.139
- Synonym(s):
- heteroxanthine
- 3,7-dihydro-7-methyl-1H-purine-2,6-dione
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
