Difference between revisions of "CPD-9869"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_8153 == * Synonym(s): == Reactions associated == * 3.6.3.50-RXN ** pantograph-esiliculosus * ATPASE-RXN ** pantograph-...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9869 CPD-9869] == * smiles: ** CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CC...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9869 CPD-9869] == |
| + | * smiles: | ||
| + | ** CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(C(=C(OC)C=C(C=1)O)O))C)C)C)C)C)C)C)C)C)C | ||
| + | * common name: | ||
| + | ** 2-methoxy-6-all trans-decaprenyl-2-methoxy-1,4-benzoquinol | ||
| + | * inchi key: | ||
| + | ** InChIKey=LIOKNOIJMJKVCG-RDSVHMIISA-N | ||
| + | * molecular weight: | ||
| + | ** 821.32 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** 2-methoxy-6-decaprenyl-2-methoxy-1,4-benzoquinol | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-9235]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | == | + | |
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50986248 50986248] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=64180 64180] | ||
| + | {{#set: smiles=CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(C(=C(OC)C=C(C=1)O)O))C)C)C)C)C)C)C)C)C)C}} | ||
| + | {{#set: common name=2-methoxy-6-all trans-decaprenyl-2-methoxy-1,4-benzoquinol}} | ||
| + | {{#set: inchi key=InChIKey=LIOKNOIJMJKVCG-RDSVHMIISA-N}} | ||
| + | {{#set: molecular weight=821.32 }} | ||
| + | {{#set: common name=2-methoxy-6-decaprenyl-2-methoxy-1,4-benzoquinol}} | ||
| + | {{#set: consumed by=RXN-9235}} | ||
Latest revision as of 19:06, 21 March 2018
Contents
Metabolite CPD-9869
- smiles:
- CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(C(=C(OC)C=C(C=1)O)O))C)C)C)C)C)C)C)C)C)C
- common name:
- 2-methoxy-6-all trans-decaprenyl-2-methoxy-1,4-benzoquinol
- inchi key:
- InChIKey=LIOKNOIJMJKVCG-RDSVHMIISA-N
- molecular weight:
- 821.32
- Synonym(s):
- 2-methoxy-6-decaprenyl-2-methoxy-1,4-benzoquinol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
