Difference between revisions of "Tiso gene 4096"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10139 CPD-10139] == * smiles: ** C=C(C1(CCC2(C(C1)O2)(C)))C * inchi key: ** InChIKey=CCEFMU...") |
(Created page with "Category:Gene == Gene Tiso_gene_4096 == * Synonym(s): == Reactions associated == * Reaction: 2.4.1.46-RXN ** Source: orthology-athaliana ** Source: orthology-es...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene Tiso_gene_4096 == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | == | + | == Reactions associated == |
| − | + | * Reaction: [[2.4.1.46-RXN]] | |
| − | == | + | ** Source: [[orthology-athaliana]] |
| − | * [[ | + | ** Source: [[orthology-esiliculosus]] |
| + | == Pathways associated == | ||
| + | * [[PWY-401]] | ||
== External links == | == External links == | ||
| − | + | {{#set: reaction associated=2.4.1.46-RXN}} | |
| − | + | {{#set: pathway associated=PWY-401}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
Latest revision as of 19:23, 21 March 2018
Gene Tiso_gene_4096
- Synonym(s):
Reactions associated
- Reaction: 2.4.1.46-RXN
- Source: orthology-athaliana
- Source: orthology-esiliculosus
