Difference between revisions of "Alpha-tubulins"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-95 CPD1F-95] == * smiles: ** C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C)([CH](CC2)3)4)C([O-])=O)...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Alpha-tubulins Alpha-tubulins] == * common name: ** α-tubulin * Synonym(s): == Reaction(...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-95 CPD1F-95] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Alpha-tubulins Alpha-tubulins] ==
* smiles:
+
** C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))
+
* inchi key:
+
** InChIKey=UJFQJDAESQJXTG-UFUZVNNQSA-L
+
 
* common name:
 
* common name:
** gibberellin A12
+
** α-tubulin
* molecular weight:
+
** 330.423   
+
 
* Synonym(s):
 
* Synonym(s):
** C20-GAs
 
** open lactone gibberrellin skeleton
 
** C20 skeleton
 
** C20-GA skeleton
 
** C20-gibberellin skeleton
 
** GA12
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN1F-162]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN1F-161]]
+
* [[6.3.2.25-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* LIPID_MAPS : LMPR0104170014
+
{{#set: common name=α-tubulin}}
* PUBCHEM:
+
{{#set: produced by=6.3.2.25-RXN}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244528 25244528]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58627 58627]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C11857 C11857]
+
{{#set: smiles=C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))}}
+
{{#set: inchi key=InChIKey=UJFQJDAESQJXTG-UFUZVNNQSA-L}}
+
{{#set: common name=gibberellin A12}}
+
{{#set: molecular weight=330.423    }}
+
{{#set: common name=C20-GAs|open lactone gibberrellin skeleton|C20 skeleton|C20-GA skeleton|C20-gibberellin skeleton|GA12}}
+
{{#set: consumed by=RXN1F-162}}
+
{{#set: produced by=RXN1F-161}}
+

Latest revision as of 19:06, 21 March 2018

Metabolite Alpha-tubulins

  • common name:
    • α-tubulin
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links