Difference between revisions of "CPD1F-95"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_13144 == * left end position: ** 4873 * transcription direction: ** POSITIVE * right end position: ** 6355 * centisome position: ** 74.9923...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-95 CPD1F-95] == * smiles: ** C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C)([CH](CC2)3)4)C([O-])=O)...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_13144 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-95 CPD1F-95] ==
−
* left end position:
+
* smiles:
−
** 4873
+
** C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))
−
* transcription direction:
+
* common name:
−
** POSITIVE
+
** gibberellin A12
−
* right end position:
+
* inchi key:
−
** 6355
+
** InChIKey=UJFQJDAESQJXTG-UFUZVNNQSA-L
−
* centisome position:
+
* molecular weight:
−
** 74.9923    
+
** 330.423    
 
* Synonym(s):
 
* Synonym(s):
 +
** C20-GAs
 +
** open lactone gibberrellin skeleton
 +
** C20 skeleton
 +
** C20-GA skeleton
 +
** C20-gibberellin skeleton
 +
** GA12
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[ACETYLGLUTKIN-RXN]]
+
* [[RXN1F-162]]
−
** in-silico_annotation
+
== Reaction(s) known to produce the compound ==
−
***automated-name-match
+
* [[RXN1F-161]]
−
** experimental_annotation
+
== Reaction(s) of unknown directionality ==
−
***automated-name-match
+
−
** [[pantograph]]-[[athaliana]]
+
−
** [[pantograph]]-[[synechocystis]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
* [[AGK]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
* [[RXN-15005]]
+
−
** in-silico_annotation
+
−
***automated-name-match
+
−
** experimental_annotation
+
−
***automated-name-match
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways associated ==
+
−
* [[PWY-5154]]
+
−
* [[GLUTORN-PWY]]
+
−
* [[ARGSYNBSUB-PWY]]
+
−
* [[PWY-7400]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=4873}}
+
* LIPID_MAPS : LMPR0104170014
−
{{#set: transcription direction=POSITIVE}}
+
* PUBCHEM:
−
{{#set: right end position=6355}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244528 25244528]
−
{{#set: centisome position=74.9923   }}
+
* CHEBI:
−
{{#set: reaction associated=ACETYLGLUTKIN-RXN|AGK|RXN-15005}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58627 58627]
−
{{#set: pathway associated=PWY-5154|GLUTORN-PWY|ARGSYNBSUB-PWY|PWY-7400}}
+
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C11857 C11857]
 +
{{#set: smiles=C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))}}
 +
{{#set: common name=gibberellin A12}}
 +
{{#set: inchi key=InChIKey=UJFQJDAESQJXTG-UFUZVNNQSA-L}}
 +
{{#set: molecular weight=330.423   }}
 +
{{#set: common name=C20-GAs|open lactone gibberrellin skeleton|C20 skeleton|C20-GA skeleton|C20-gibberellin skeleton|GA12}}
 +
{{#set: consumed by=RXN1F-162}}
 +
{{#set: produced by=RXN1F-161}}

Latest revision as of 19:06, 21 March 2018

Metabolite CPD1F-95

  • smiles:
    • C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))
  • common name:
    • gibberellin A12
  • inchi key:
    • InChIKey=UJFQJDAESQJXTG-UFUZVNNQSA-L
  • molecular weight:
    • 330.423
  • Synonym(s):
    • C20-GAs
    • open lactone gibberrellin skeleton
    • C20 skeleton
    • C20-GA skeleton
    • C20-gibberellin skeleton
    • GA12

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD1F-95&oldid=39531"