Difference between revisions of "Tiso gene 17230"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11401 CPD-11401] == * smiles: ** C([O-])(=O)C1(OC(C(O)C(O)C(O)1)OC(=O)C(N)CC2(=CC(I)=C(C(I)...")
(Created page with "Category:Gene == Gene Tiso_gene_17230 == * right end position: ** 253 * transcription direction: ** POSITIVE * left end position: ** 1 * centisome position: ** 2.603488600...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11401 CPD-11401] ==
+
== Gene Tiso_gene_17230 ==
−
* smiles:
+
* right end position:
−
** C([O-])(=O)C1(OC(C(O)C(O)C(O)1)OC(=O)C(N)CC2(=CC(I)=C(C(I)=C2)OC3(=CC(I)=C(O)C(I)=C3)))
+
** 253
−
* inchi key:
+
* transcription direction:
−
** InChIKey=HMTFXPJOBPIOIN-DKBYMCRTSA-M
+
** POSITIVE
−
* common name:
+
* left end position:
−
** L-thyroxine acyl β-D-glucuronide
+
** 1
−
* molecular weight:
+
* centisome position:
−
** 951.992   
+
** 2.603488600e-2
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[PEPTIDYLPROLYL-ISOMERASE-RXN]]
−
* [[RXN-10608]]
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=253}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657991 90657991]
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: smiles=C([O-])(=O)C1(OC(C(O)C(O)C(O)1)OC(=O)C(N)CC2(=CC(I)=C(C(I)=C2)OC3(=CC(I)=C(O)C(I)=C3)))}}
+
{{#set: left end position=1}}
−
{{#set: inchi key=InChIKey=HMTFXPJOBPIOIN-DKBYMCRTSA-M}}
+
{{#set: centisome position=2.603488600e-2}}
−
{{#set: common name=L-thyroxine acyl β-D-glucuronide}}
+
{{#set: reaction associated=PEPTIDYLPROLYL-ISOMERASE-RXN}}
−
{{#set: molecular weight=951.992    }}
+
−
{{#set: produced by=RXN-10608}}
+

Latest revision as of 20:06, 21 March 2018

Gene Tiso_gene_17230

  • right end position:
    • 253
  • transcription direction:
    • POSITIVE
  • left end position:
    • 1
  • centisome position:
    • 2.603488600e-2
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_17230&oldid=39533"