Difference between revisions of "CPD0-1065"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15589 RXN-15589] == * direction: ** REVERSIBLE * ec number: ** [http://enzyme.expasy.org/EC/2.8...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1065 CPD0-1065] == * smiles: ** C(CC[N+]CCCCC[N+])[N+] * common name: ** aminopropylcadave...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15589 RXN-15589] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1065 CPD0-1065] ==
* direction:
+
* smiles:
** REVERSIBLE
+
** C(CC[N+]CCCCC[N+])[N+]
* ec number:
+
* common name:
** [http://enzyme.expasy.org/EC/2.8.2.1 EC-2.8.2.1]
+
** aminopropylcadaverine
 +
* inchi key:
 +
** InChIKey=QZBYOYPROVGOGE-UHFFFAOYSA-Q
 +
* molecular weight:
 +
** 162.298   
 
* Synonym(s):
 
* Synonym(s):
 +
** N-3-aminopropyl-1,5-diaminopentane
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
== Reaction(s) known to produce the compound ==
** 1 [[PAPS]][c] '''+''' 1 [[CPD-14115]][c] '''<=>''' 1 [[CPD-16825]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[3-5-ADP]][c]
+
* [[RXN0-5217]]
* With common name(s):
+
== Reaction(s) of unknown directionality ==
** 1 3'-phosphoadenylyl-sulfate[c] '''+''' 1 (S)-equol[c] '''<=>''' 1 (S)-equol 4'-sulfate[c] '''+''' 1 H+[c] '''+''' 1 adenosine 3',5'-bisphosphate[c]
+
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* [[Tiso_gene_5505]]
+
** [[pantograph]]-[[esiliculosus]]
+
== Pathways  ==
+
== Reconstruction information  ==
+
* Category: [[orthology]]
+
** Source: [[orthology-esiliculosus]]
+
*** Tool: [[pantograph]]
+
 
== External links  ==
 
== External links  ==
{{#set: direction=REVERSIBLE}}
+
* PUBCHEM:
{{#set: ec number=EC-2.8.2.1}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246266 25246266]
{{#set: gene associated=Tiso_gene_5505}}
+
* HMDB : HMDB12189
{{#set: in pathway=}}
+
* CHEBI:
{{#set: reconstruction category=orthology}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=64858 64858]
{{#set: reconstruction source=orthology-esiliculosus}}
+
* LIGAND-CPD:
{{#set: reconstruction tool=pantograph}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C16565 C16565]
 +
{{#set: smiles=C(CC[N+]CCCCC[N+])[N+]}}
 +
{{#set: common name=aminopropylcadaverine}}
 +
{{#set: inchi key=InChIKey=QZBYOYPROVGOGE-UHFFFAOYSA-Q}}
 +
{{#set: molecular weight=162.298    }}
 +
{{#set: common name=N-3-aminopropyl-1,5-diaminopentane}}
 +
{{#set: produced by=RXN0-5217}}

Latest revision as of 20:06, 21 March 2018

Metabolite CPD0-1065

  • smiles:
    • C(CC[N+]CCCCC[N+])[N+]
  • common name:
    • aminopropylcadaverine
  • inchi key:
    • InChIKey=QZBYOYPROVGOGE-UHFFFAOYSA-Q
  • molecular weight:
    • 162.298
  • Synonym(s):
    • N-3-aminopropyl-1,5-diaminopentane

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(CC[N+]CCCCC[N+])[N+" cannot be used as a page name in this wiki.