Difference between revisions of "Tiso gene 8353"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=XANTHOSINE XANTHOSINE] == * smiles: ** C(O)C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(=O)NC=23))) * inchi...") |
(Created page with "Category:Gene == Gene Tiso_gene_8353 == * right end position: ** 6959 * transcription direction: ** NEGATIVE * left end position: ** 4577 * centisome position: ** 44.35937...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_8353 == |
− | * | + | * right end position: |
− | ** | + | ** 6959 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * left end position: |
− | ** | + | ** 4577 |
− | * | + | * centisome position: |
− | ** | + | ** 44.35937 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[LYSOPHOSPHOLIPASE-RXN]] |
− | * [[ | + | ** Source: [[annotation-experimental_annotation]] |
− | + | *** Assignment: automated-name-match | |
− | * [[ | + | * Reaction: [[RXN-15035]] |
− | * [[ | + | ** Source: [[annotation-experimental_annotation]] |
− | == | + | *** Assignment: automated-name-match |
+ | == Pathways associated == | ||
+ | * [[PWY-7409]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=6959}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: left end position=4577}} | |
− | + | {{#set: centisome position=44.35937 }} | |
− | + | {{#set: reaction associated=LYSOPHOSPHOLIPASE-RXN|RXN-15035}} | |
− | + | {{#set: pathway associated=PWY-7409}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + |
Latest revision as of 19:06, 21 March 2018
Gene Tiso_gene_8353
- right end position:
- 6959
- transcription direction:
- NEGATIVE
- left end position:
- 4577
- centisome position:
- 44.35937
- Synonym(s):
Reactions associated
- Reaction: LYSOPHOSPHOLIPASE-RXN
- Source: annotation-experimental_annotation
- Assignment: automated-name-match
- Source: annotation-experimental_annotation
- Reaction: RXN-15035
- Source: annotation-experimental_annotation
- Assignment: automated-name-match
- Source: annotation-experimental_annotation