|
|
(One intermediate revision by the same user not shown) |
Line 1: |
Line 1: |
− | [[Category:Pathway]] | + | [[Category:Metabolite]] |
− | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=TRNA-CHARGING-PWY TRNA-CHARGING-PWY] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=XANTHOSINE XANTHOSINE] == |
− | * taxonomic range: | + | * smiles: |
− | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759] | + | ** C(O)C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(=O)NC=23))) |
− | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
| + | |
− | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
| + | |
| * common name: | | * common name: |
− | ** tRNA charging | + | ** xanthosine |
| + | * inchi key: |
| + | ** InChIKey=UBORTCNDUKBEOP-UUOKFMHZSA-N |
| + | * molecular weight: |
| + | ** 284.228 |
| * Synonym(s): | | * Synonym(s): |
| + | ** 9 β-D-ribofuranosylxanthine |
| | | |
− | == Reaction(s) found == | + | == Reaction(s) known to consume the compound == |
− | '''21''' reactions found over '''21''' reactions in the full pathway
| + | * [[RXN0-363]] |
− | * [[ALANINE--TRNA-LIGASE-RXN]] | + | * [[XANTHOSINEPHOSPHORY-RXN]] |
− | ** 5 associated gene(s):
| + | == Reaction(s) known to produce the compound == |
− | *** [[Tiso_gene_2298]]
| + | * [[X5NT]] |
− | *** [[Tiso_gene_3249]]
| + | * [[XMPXAN-RXN]] |
− | *** [[Tiso_gene_18607]]
| + | == Reaction(s) of unknown directionality == |
− | *** [[Tiso_gene_18609]]
| + | |
− | *** [[Tiso_gene_19573]]
| + | |
− | ** 3 reconstruction source(s) associated:
| + | |
− | *** [[annotation-in-silico_annotation]]
| + | |
− | *** [[annotation-experimental_annotation]]
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[ARGININE--TRNA-LIGASE-RXN]]
| + | |
− | ** 2 associated gene(s):
| + | |
− | *** [[Tiso_gene_12997]]
| + | |
− | *** [[Tiso_gene_16360]]
| + | |
− | ** 3 reconstruction source(s) associated:
| + | |
− | *** [[annotation-in-silico_annotation]]
| + | |
− | *** [[annotation-experimental_annotation]]
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[ASPARAGINE--TRNA-LIGASE-RXN]]
| + | |
− | ** 5 associated gene(s):
| + | |
− | *** [[Tiso_gene_9303]]
| + | |
− | *** [[Tiso_gene_9304]]
| + | |
− | *** [[Tiso_gene_9908]]
| + | |
− | *** [[Tiso_gene_13908]]
| + | |
− | *** [[Tiso_gene_6065]]
| + | |
− | ** 2 reconstruction source(s) associated:
| + | |
− | *** [[annotation-experimental_annotation]]
| + | |
− | *** [[annotation-in-silico_annotation]]
| + | |
− | * [[ASPARTATE--TRNA-LIGASE-RXN]]
| + | |
− | ** 3 associated gene(s):
| + | |
− | *** [[Tiso_gene_17185]]
| + | |
− | *** [[Tiso_gene_7126]]
| + | |
− | *** [[Tiso_gene_13081]]
| + | |
− | ** 3 reconstruction source(s) associated:
| + | |
− | *** [[annotation-in-silico_annotation]]
| + | |
− | *** [[annotation-experimental_annotation]]
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[CYSTEINE--TRNA-LIGASE-RXN]]
| + | |
− | ** 2 associated gene(s):
| + | |
− | *** [[Tiso_gene_10881]]
| + | |
− | *** [[Tiso_gene_17657]]
| + | |
− | ** 3 reconstruction source(s) associated:
| + | |
− | *** [[annotation-in-silico_annotation]]
| + | |
− | *** [[annotation-experimental_annotation]]
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[GLURS-RXN]]
| + | |
− | ** 2 associated gene(s):
| + | |
− | *** [[Tiso_gene_5379]]
| + | |
− | *** [[Tiso_gene_5046]]
| + | |
− | ** 4 reconstruction source(s) associated:
| + | |
− | *** [[annotation-in-silico_annotation]]
| + | |
− | *** [[manual-primary_network]]
| + | |
− | *** [[annotation-experimental_annotation]]
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[GLUTAMINE--TRNA-LIGASE-RXN]]
| + | |
− | ** 3 associated gene(s):
| + | |
− | *** [[Tiso_gene_5915]]
| + | |
− | *** [[Tiso_gene_11124]]
| + | |
− | *** [[Tiso_gene_7596]]
| + | |
− | ** 3 reconstruction source(s) associated:
| + | |
− | *** [[annotation-experimental_annotation]]
| + | |
− | *** [[annotation-in-silico_annotation]]
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[GLYCINE--TRNA-LIGASE-RXN]]
| + | |
− | ** 3 associated gene(s):
| + | |
− | *** [[Tiso_gene_14743]]
| + | |
− | *** [[Tiso_gene_14742]]
| + | |
− | *** [[Tiso_gene_3788]]
| + | |
− | ** 3 reconstruction source(s) associated:
| + | |
− | *** [[annotation-in-silico_annotation]]
| + | |
− | *** [[annotation-experimental_annotation]]
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[HISTIDINE--TRNA-LIGASE-RXN]]
| + | |
− | ** 3 associated gene(s):
| + | |
− | *** [[Tiso_gene_12634]]
| + | |
− | *** [[Tiso_gene_13414]]
| + | |
− | *** [[Tiso_gene_8798]]
| + | |
− | ** 3 reconstruction source(s) associated:
| + | |
− | *** [[annotation-in-silico_annotation]]
| + | |
− | *** [[annotation-experimental_annotation]]
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[ISOLEUCINE--TRNA-LIGASE-RXN]]
| + | |
− | ** 2 associated gene(s):
| + | |
− | *** [[Tiso_gene_12496]]
| + | |
− | *** [[Tiso_gene_11779]]
| + | |
− | ** 3 reconstruction source(s) associated:
| + | |
− | *** [[annotation-in-silico_annotation]]
| + | |
− | *** [[annotation-experimental_annotation]]
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[LEUCINE--TRNA-LIGASE-RXN]]
| + | |
− | ** 2 associated gene(s):
| + | |
− | *** [[Tiso_gene_11524]]
| + | |
− | *** [[Tiso_gene_15439]]
| + | |
− | ** 3 reconstruction source(s) associated:
| + | |
− | *** [[annotation-experimental_annotation]]
| + | |
− | *** [[annotation-in-silico_annotation]]
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[LYSINE--TRNA-LIGASE-RXN]]
| + | |
− | ** 2 associated gene(s):
| + | |
− | *** [[Tiso_gene_6705]]
| + | |
− | *** [[Tiso_gene_16635]]
| + | |
− | ** 3 reconstruction source(s) associated:
| + | |
− | *** [[annotation-in-silico_annotation]]
| + | |
− | *** [[annotation-experimental_annotation]]
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[METHIONINE--TRNA-LIGASE-RXN]]
| + | |
− | ** 2 associated gene(s):
| + | |
− | *** [[Tiso_gene_284]]
| + | |
− | *** [[Tiso_gene_406]]
| + | |
− | ** 3 reconstruction source(s) associated:
| + | |
− | *** [[annotation-in-silico_annotation]]
| + | |
− | *** [[annotation-experimental_annotation]]
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[PHENYLALANINE--TRNA-LIGASE-RXN]]
| + | |
− | ** 4 associated gene(s):
| + | |
− | *** [[Tiso_gene_16467]]
| + | |
− | *** [[Tiso_gene_4232]]
| + | |
− | *** [[Tiso_gene_16650]]
| + | |
− | *** [[Tiso_gene_1625]]
| + | |
− | ** 3 reconstruction source(s) associated:
| + | |
− | *** [[annotation-in-silico_annotation]]
| + | |
− | *** [[annotation-experimental_annotation]]
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[PROLINE--TRNA-LIGASE-RXN]]
| + | |
− | ** 2 associated gene(s):
| + | |
− | *** [[Tiso_gene_11974]]
| + | |
− | *** [[Tiso_gene_14791]]
| + | |
− | ** 3 reconstruction source(s) associated:
| + | |
− | *** [[annotation-experimental_annotation]]
| + | |
− | *** [[annotation-in-silico_annotation]]
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[RXN-16165]]
| + | |
− | ** 2 associated gene(s):
| + | |
− | *** [[Tiso_gene_406]]
| + | |
− | *** [[Tiso_gene_284]]
| + | |
− | ** 2 reconstruction source(s) associated:
| + | |
− | *** [[annotation-in-silico_annotation]]
| + | |
− | *** [[annotation-experimental_annotation]]
| + | |
− | * [[SERINE--TRNA-LIGASE-RXN]]
| + | |
− | ** 4 associated gene(s):
| + | |
− | *** [[Tiso_gene_1682]]
| + | |
− | *** [[Tiso_gene_10015]]
| + | |
− | *** [[Tiso_gene_1684]]
| + | |
− | *** [[Tiso_gene_587]]
| + | |
− | ** 3 reconstruction source(s) associated:
| + | |
− | *** [[annotation-in-silico_annotation]]
| + | |
− | *** [[annotation-experimental_annotation]]
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[THREONINE--TRNA-LIGASE-RXN]]
| + | |
− | ** 2 associated gene(s):
| + | |
− | *** [[Tiso_gene_13142]]
| + | |
− | *** [[Tiso_gene_4406]]
| + | |
− | ** 3 reconstruction source(s) associated:
| + | |
− | *** [[annotation-experimental_annotation]]
| + | |
− | *** [[annotation-in-silico_annotation]]
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[TRYPTOPHAN--TRNA-LIGASE-RXN]]
| + | |
− | ** 3 associated gene(s):
| + | |
− | *** [[Tiso_gene_14318]]
| + | |
− | *** [[Tiso_gene_14319]]
| + | |
− | *** [[Tiso_gene_12988]]
| + | |
− | ** 3 reconstruction source(s) associated:
| + | |
− | *** [[annotation-experimental_annotation]]
| + | |
− | *** [[annotation-in-silico_annotation]]
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[TYROSINE--TRNA-LIGASE-RXN]]
| + | |
− | ** 4 associated gene(s):
| + | |
− | *** [[Tiso_gene_4174]]
| + | |
− | *** [[Tiso_gene_12171]]
| + | |
− | *** [[Tiso_gene_10378]]
| + | |
− | *** [[Tiso_gene_4175]]
| + | |
− | ** 3 reconstruction source(s) associated:
| + | |
− | *** [[annotation-in-silico_annotation]]
| + | |
− | *** [[annotation-experimental_annotation]]
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | * [[VALINE--TRNA-LIGASE-RXN]]
| + | |
− | ** 2 associated gene(s):
| + | |
− | *** [[Tiso_gene_1372]]
| + | |
− | *** [[Tiso_gene_8041]]
| + | |
− | ** 3 reconstruction source(s) associated:
| + | |
− | *** [[annotation-in-silico_annotation]]
| + | |
− | *** [[annotation-experimental_annotation]]
| + | |
− | *** [[orthology-esiliculosus]]
| + | |
− | == Reaction(s) not found == | + | |
| == External links == | | == External links == |
− | * ECOCYC: | + | * CAS : 146-80-5 |
− | ** [http://metacyc.org/ECOLI/NEW-IMAGE?object=TRNA-CHARGING-PWY TRNA-CHARGING-PWY] | + | * BIGG : xtsn |
− | {{#set: taxonomic range=TAX-2759}} | + | * PUBCHEM: |
− | {{#set: taxonomic range=TAX-2}} | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=64959 64959] |
− | {{#set: taxonomic range=TAX-2157}} | + | * HMDB : HMDB00299 |
− | {{#set: common name=tRNA charging}} | + | * LIGAND-CPD: |
− | {{#set: reaction found=21}} | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01762 C01762] |
− | {{#set: total reaction=21}} | + | * CHEMSPIDER: |
− | {{#set: completion rate=100.0}} | + | ** [http://www.chemspider.com/Chemical-Structure.1152.html 1152] |
| + | * CHEBI: |
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18107 18107] |
| + | * METABOLIGHTS : MTBLC18107 |
| + | {{#set: smiles=C(O)C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(=O)NC=23)))}} |
| + | {{#set: common name=xanthosine}} |
| + | {{#set: inchi key=InChIKey=UBORTCNDUKBEOP-UUOKFMHZSA-N}} |
| + | {{#set: molecular weight=284.228 }} |
| + | {{#set: common name=9 β-D-ribofuranosylxanthine}} |
| + | {{#set: consumed by=RXN0-363|XANTHOSINEPHOSPHORY-RXN}} |
| + | {{#set: produced by=X5NT|XMPXAN-RXN}} |