Difference between revisions of "LUTEOLIN-7-O-BETA-D-DIGLUCURONIDE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PE1819Z1819Zt PE1819Z1819Zt] == * direction: ** LEFT-TO-RIGHT * common name: ** Aminophospholipid t...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LUTEOLIN-7-O-BETA-D-DIGLUCURONIDE LUTEOLIN-7-O-BETA-D-DIGLUCURONIDE] == * smiles: ** C(C5(OC(OC...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=PE1819Z1819Zt PE1819Z1819Zt] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LUTEOLIN-7-O-BETA-D-DIGLUCURONIDE LUTEOLIN-7-O-BETA-D-DIGLUCURONIDE] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(C5(OC(OC1(C(C(C(C([O-])=O)OC1OC4(C=C3(C(C(C=C(C2(=CC=C(C(=C2)O)O))O3)=O)=C(C=4)O)))O)O))C(C(C5O)O)O))([O-])=O
 
* common name:
 
* common name:
−
** Aminophospholipid translocase (pe1819Z1819Z), extracellular
+
** luteolin 7-O-β-D-diglucuronide
 +
* inchi key:
 +
** InChIKey=PBBVWJQPAZYQDB-DBFWEQBMSA-L
 +
* molecular weight:
 +
** 636.476   
 
* Synonym(s):
 
* Synonym(s):
 +
** luteolin 7-O-[β-D-glucosyluronate-(1->2)-β-D-glucuronide]
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-15288]]
−
** 1.0 [[ATP]][c] '''+''' 1.0 [[WATER]][c] '''+''' 1.0 [[CPD-8291]][c] '''=>''' 1.0 [[ADP]][c] '''+''' 1.0 [[Pi]][c] '''+''' 1.0 [[CPD-8291]][e] '''+''' 1.0 [[PROTON]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[RXN-15289]]
−
** 1.0 ATP[c] '''+''' 1.0 H2O[c] '''+''' 1.0 1-18:1-2-18:1-phosphatidylethanolamine[c] '''=>''' 1.0 ADP[c] '''+''' 1.0 phosphate[c] '''+''' 1.0 1-18:1-2-18:1-phosphatidylethanolamine[e] '''+''' 1.0 H+[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_11648]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-creinhardtii]]
+
−
*** Tool: [[pantograph]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=Aminophospholipid translocase (pe1819Z1819Z), extracellular}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878427 46878427]
−
{{#set: gene associated=Tiso_gene_11648}}
+
* HMDB : HMDB60297
−
{{#set: in pathway=}}
+
* CHEBI:
−
{{#set: reconstruction category=orthology}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57815 57815]
−
{{#set: reconstruction source=orthology-creinhardtii}}
+
* LIGAND-CPD:
−
{{#set: reconstruction tool=pantograph}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C12632 C12632]
 +
{{#set: smiles=C(C5(OC(OC1(C(C(C(C([O-])=O)OC1OC4(C=C3(C(C(C=C(C2(=CC=C(C(=C2)O)O))O3)=O)=C(C=4)O)))O)O))C(C(C5O)O)O))([O-])=O}}
 +
{{#set: common name=luteolin 7-O-β-D-diglucuronide}}
 +
{{#set: inchi key=InChIKey=PBBVWJQPAZYQDB-DBFWEQBMSA-L}}
 +
{{#set: molecular weight=636.476    }}
 +
{{#set: common name=luteolin 7-O-[β-D-glucosyluronate-(1->2)-β-D-glucuronide]}}
 +
{{#set: consumed by=RXN-15288}}
 +
{{#set: produced by=RXN-15289}}

Latest revision as of 19:06, 21 March 2018

Metabolite LUTEOLIN-7-O-BETA-D-DIGLUCURONIDE

  • smiles:
    • C(C5(OC(OC1(C(C(C(C([O-])=O)OC1OC4(C=C3(C(C(C=C(C2(=CC=C(C(=C2)O)O))O3)=O)=C(C=4)O)))O)O))C(C(C5O)O)O))([O-])=O
  • common name:
    • luteolin 7-O-β-D-diglucuronide
  • inchi key:
    • InChIKey=PBBVWJQPAZYQDB-DBFWEQBMSA-L
  • molecular weight:
    • 636.476
  • Synonym(s):
    • luteolin 7-O-[β-D-glucosyluronate-(1->2)-β-D-glucuronide]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(C5(OC(OC1(C(C(C(C([O-])=O)OC1OC4(C=C3(C(C(C=C(C2(=CC=C(C(=C2)O)O))O3)=O)=C(C=4)O)))O)O))C(C(C5O)O)O))([O-])=O" cannot be used as a page name in this wiki.


"luteolin 7-O-[β-D-glucosyluronate-(1->2)-β-D-glucuronide" cannot be used as a page name in this wiki.


Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=LUTEOLIN-7-O-BETA-D-DIGLUCURONIDE&oldid=39549"