Difference between revisions of "Tiso gene 3211"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14916 CPD-14916] == * smiles: ** CCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(...")
(Created page with "Category:Gene == Gene Tiso_gene_3211 == * right end position: ** 6161 * transcription direction: ** POSITIVE * left end position: ** 5162 * centisome position: ** 29.94199...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14916 CPD-14916] ==
+
== Gene Tiso_gene_3211 ==
* smiles:
+
* right end position:
** CCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)O
+
** 6161
* inchi key:
+
* transcription direction:
** InChIKey=ATVGTMKWKDUCMS-JWBYWSJJSA-J
+
** POSITIVE
* common name:
+
* left end position:
** (R)-3-hydroxyoctanoyl-CoA
+
** 5162
* molecular weight:
+
* centisome position:
** 905.7    
+
** 29.941994    
 
* Synonym(s):
 
* Synonym(s):
** (R)-3-hydroxyoctanoyl-CoA
 
** (3R)-3-hydroxyoctanoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-14275]]
+
* Reaction: [[RXN-15556]]
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
* [[RXN-14276]]
+
*** Assignment: ec-number
== Reaction(s) of unknown directionality ==
+
* Reaction: [[UBIQUITIN--PROTEIN-LIGASE-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways associated ==
 +
* [[PWY-7511]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: right end position=6161}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173319 46173319]
+
{{#set: transcription direction=POSITIVE}}
* CHEBI:
+
{{#set: left end position=5162}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74279 74279]
+
{{#set: centisome position=29.941994   }}
* BIGG : 3hocoa
+
{{#set: reaction associated=RXN-15556|UBIQUITIN--PROTEIN-LIGASE-RXN}}
{{#set: smiles=CCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)O}}
+
{{#set: pathway associated=PWY-7511}}
{{#set: inchi key=InChIKey=ATVGTMKWKDUCMS-JWBYWSJJSA-J}}
+
{{#set: common name=(R)-3-hydroxyoctanoyl-CoA}}
+
{{#set: molecular weight=905.7   }}
+
{{#set: common name=(R)-3-hydroxyoctanoyl-CoA|(3R)-3-hydroxyoctanoyl-CoA}}
+
{{#set: consumed by=RXN-14275}}
+
{{#set: produced by=RXN-14276}}
+

Latest revision as of 20:06, 21 March 2018

Gene Tiso_gene_3211

  • right end position:
    • 6161
  • transcription direction:
    • POSITIVE
  • left end position:
    • 5162
  • centisome position:
    • 29.941994
  • Synonym(s):

Reactions associated

Pathways associated

External links